C28H41N5O3 — CID 142194406
N-ethylformamide;(9R)-N-methyl-N-[3-(2-oxopropylamino)propyl]-7-prop-2-enyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide (PubChem CID 142194406) has the molecular formula C28H41N5O3 and a molecular weight of 495.67 g/mol. Its IUPAC name is N-ethylformamide;(9R)-N-methyl-N-[3-(2-oxopropylamino)propyl]-7-prop-2-enyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide.
| Compound Name | N-ethylformamide;(9R)-N-methyl-N-[3-(2-oxopropylamino)propyl]-7-prop-2-enyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide |
|---|---|
| PubChem CID | 142194406 |
| Molecular Formula | C28H41N5O3 |
| Molecular Weight | 495.67 g/mol |
| Exact Mass | 495.32 |
| IUPAC Name | N-ethylformamide;(9R)-N-methyl-N-[3-(2-oxopropylamino)propyl]-7-prop-2-enyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide |
| SMILES | C=CCN1C[C@H](C(=O)N(C)CCCNCC(C)=O)CC2c3cccc4[nH]cc(c34)CC21.CCNC=O |
| InChI | InChI=1S/C25H34N4O2.C3H7NO/c1-4-10-29-16-19(25(31)28(3)11-6-9-26-14-17(2)30)12-21-20-7-5-8-22-24(20)18(15-27-22)13-23(21)29;1-2-4-3-5/h4-5,7-8,15,19,21,23,26-27H,1,6,9-14,16H2,2-3H3;3H,2H2,1H3,(H,4,5)/t19-,21?,23?;/m1./s1 |
| InChIKey | PXBCTPFXBUQHKW-QDXAHCSKSA-N |
| XLogP | 2.46 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.67 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|