C30H39N3O5S — CID 142194769
N-[(2S,3S)-4-[(4S)-4-ethenyl-7-methyl-5-oxo-6-[(E)-pent-2-enyl]-1,3,6-thiadiazepan-3-yl]-3,4-dihydroxy-1-phenylbutan-2-yl]-3-hydroxy-2-methylbenzamide (PubChem CID 142194769) has the molecular formula C30H39N3O5S and a molecular weight of 553.73 g/mol. Its IUPAC name is N-[(2S,3S)-4-[(4S)-4-ethenyl-7-methyl-5-oxo-6-[(E)-pent-2-enyl]-1,3,6-thiadiazepan-3-yl]-3,4-dihydroxy-1-phenylbutan-2-yl]-3-hydroxy-2-methylbenzamide.
| Compound Name | N-[(2S,3S)-4-[(4S)-4-ethenyl-7-methyl-5-oxo-6-[(E)-pent-2-enyl]-1,3,6-thiadiazepan-3-yl]-3,4-dihydroxy-1-phenylbutan-2-yl]-3-hydroxy-2-methylbenzamide |
|---|---|
| PubChem CID | 142194769 |
| Molecular Formula | C30H39N3O5S |
| Molecular Weight | 553.73 g/mol |
| Exact Mass | 553.26 |
| IUPAC Name | N-[(2S,3S)-4-[(4S)-4-ethenyl-7-methyl-5-oxo-6-[(E)-pent-2-enyl]-1,3,6-thiadiazepan-3-yl]-3,4-dihydroxy-1-phenylbutan-2-yl]-3-hydroxy-2-methylbenzamide |
| SMILES | C=C[C@H]1C(=O)N(C/C=C/CC)C(C)SCN1C(O)[C@@H](O)[C@H](Cc1ccccc1)NC(=O)c1cccc(O)c1C |
| InChI | InChI=1S/C30H39N3O5S/c1-5-7-11-17-32-21(4)39-19-33(25(6-2)29(32)37)30(38)27(35)24(18-22-13-9-8-10-14-22)31-28(36)23-15-12-16-26(34)20(23)3/h6-16,21,24-25,27,30,34-35,38H,2,5,17-19H2,1,3-4H3,(H,31,36)/b11-7+/t21?,24-,25-,27-,30?/m0/s1 |
| InChIKey | DEWOJBDQAVWNDE-GLIDXEEDSA-N |
| XLogP | 3.42 |
| TPSA | 113.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.73 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|