C19H24N2O4S — CID 142194951
prop-2-ynyl N-[(2S,3S)-4-(5,5-dimethyl-1,3-thiazolidin-3-yl)-3-hydroxy-4-oxo-1-phenylbutan-2-yl]carbamate (PubChem CID 142194951) has the molecular formula C19H24N2O4S and a molecular weight of 376.48 g/mol. Its IUPAC name is prop-2-ynyl N-[(2S,3S)-4-(5,5-dimethyl-1,3-thiazolidin-3-yl)-3-hydroxy-4-oxo-1-phenylbutan-2-yl]carbamate.
| Compound Name | prop-2-ynyl N-[(2S,3S)-4-(5,5-dimethyl-1,3-thiazolidin-3-yl)-3-hydroxy-4-oxo-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 142194951 |
| Molecular Formula | C19H24N2O4S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | prop-2-ynyl N-[(2S,3S)-4-(5,5-dimethyl-1,3-thiazolidin-3-yl)-3-hydroxy-4-oxo-1-phenylbutan-2-yl]carbamate |
| SMILES | C#CCOC(=O)N[C@@H](Cc1ccccc1)[C@H](O)C(=O)N1CSC(C)(C)C1 |
| InChI | InChI=1S/C19H24N2O4S/c1-4-10-25-18(24)20-15(11-14-8-6-5-7-9-14)16(22)17(23)21-12-19(2,3)26-13-21/h1,5-9,15-16,22H,10-13H2,2-3H3,(H,20,24)/t15-,16-/m0/s1 |
| InChIKey | HOFWJCUVEBYPLV-HOTGVXAUSA-N |
| XLogP | 1.63 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|