About [(Z,2E)-2-propylidenehex-4-enyl] N-(piperidin-4-ylmethyl)carbamate
[(Z,2E)-2-propylidenehex-4-enyl] N-(piperidin-4-ylmethyl)carbamate (PubChem CID 142195629) has the molecular formula C16H28N2O2
and a molecular weight of 280.41 g/mol. Its IUPAC name is [(Z,2E)-2-propylidenehex-4-enyl] N-(piperidin-4-ylmethyl)carbamate.
Molecular Properties
| Compound Name | [(Z,2E)-2-propylidenehex-4-enyl] N-(piperidin-4-ylmethyl)carbamate |
| PubChem CID | 142195629 |
| Molecular Formula | C16H28N2O2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | [(Z,2E)-2-propylidenehex-4-enyl] N-(piperidin-4-ylmethyl)carbamate |
| SMILES | C/C=C\C/C(=C\CC)COC(=O)NCC1CCNCC1 |
| InChI | InChI=1S/C16H28N2O2/c1-3-5-7-15(6-4-2)13-20-16(19)18-12-14-8-10-17-11-9-14/h3,5-6,14,17H,4,7-13H2,1-2H3,(H,18,19)/b5-3-,15-6+ |
| InChIKey | XUHNSKAIUKQLIZ-QFJUEOODSA-N |
| XLogP | 3.01 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(Z,2E)-2-propylidenehex-4-enyl] N-(piperidin-4-ylmethyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z,2E)-2-propylidenehex-4-enyl] N-(piperidin-4-ylmethyl)carbamate?
The IUPAC name of [(Z,2E)-2-propylidenehex-4-enyl] N-(piperidin-4-ylmethyl)carbamate (CID 142195629) is [(Z,2E)-2-propylidenehex-4-enyl] N-(piperidin-4-ylmethyl)carbamate.
What is the SMILES notation for [(Z,2E)-2-propylidenehex-4-enyl] N-(piperidin-4-ylmethyl)carbamate?
The canonical SMILES for [(Z,2E)-2-propylidenehex-4-enyl] N-(piperidin-4-ylmethyl)carbamate is C/C=C\C/C(=C\CC)COC(=O)NCC1CCNCC1.
What is the InChIKey of [(Z,2E)-2-propylidenehex-4-enyl] N-(piperidin-4-ylmethyl)carbamate?
The InChIKey is XUHNSKAIUKQLIZ-QFJUEOODSA-N. The full InChI is InChI=1S/C16H28N2O2/c1-3-5-7-15(6-4-2)13-20-16(19)18-12-14-8-10-17-11-9-14/h3,5-6,14,17H,4,7-13H2,1-2H3,(H,18,19)/b5-3-,15-6+.
What are the key properties of [(Z,2E)-2-propylidenehex-4-enyl] N-(piperidin-4-ylmethyl)carbamate?
[(Z,2E)-2-propylidenehex-4-enyl] N-(piperidin-4-ylmethyl)carbamate has a molecular weight of 280.41 g/mol, XLogP of 3.01, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z,2E)-2-propylidenehex-4-enyl] N-(piperidin-4-ylmethyl)carbamate is sourced from PubChem (CID 142195629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).