C33H14F10O8 — CID 142195910
5-[[4-[2-[4-[(1,3-dioxo-2-benzofuran-5-yl)oxy-difluoromethyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-difluoromethoxy]-2-benzofuran-1,3-dione (PubChem CID 142195910) has the molecular formula C33H14F10O8 and a molecular weight of 728.45 g/mol. Its IUPAC name is 5-[[4-[2-[4-[(1,3-dioxo-2-benzofuran-5-yl)oxy-difluoromethyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-difluoromethoxy]-2-benzofuran-1,3-dione.
| Compound Name | 5-[[4-[2-[4-[(1,3-dioxo-2-benzofuran-5-yl)oxy-difluoromethyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-difluoromethoxy]-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 142195910 |
| Molecular Formula | C33H14F10O8 |
| Molecular Weight | 728.45 g/mol |
| Exact Mass | 728.05 |
| IUPAC Name | 5-[[4-[2-[4-[(1,3-dioxo-2-benzofuran-5-yl)oxy-difluoromethyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-difluoromethoxy]-2-benzofuran-1,3-dione |
| SMILES | O=C1OC(=O)c2cc(OC(F)(F)c3ccc(C(c4ccc(C(F)(F)Oc5ccc6c(c5)C(=O)OC6=O)cc4)(C(F)(F)F)C(F)(F)F)cc3)ccc21 |
| InChI | InChI=1S/C33H14F10O8/c34-30(35,50-19-9-11-21-23(13-19)27(46)48-25(21)44)17-5-1-15(2-6-17)29(32(38,39)40,33(41,42)43)16-3-7-18(8-4-16)31(36,37)51-20-10-12-22-24(14-20)28(47)49-26(22)45/h1-14H |
| InChIKey | HQRDNIJSECYORU-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.45 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|