About ethane;methyl (4Z,5E)-1-acetyl-4,5-di(ethylidene)pyrrolidine-2-carboxylate
ethane;methyl (4Z,5E)-1-acetyl-4,5-di(ethylidene)pyrrolidine-2-carboxylate (PubChem CID 142196399) has the molecular formula C14H23NO3
and a molecular weight of 253.34 g/mol. Its IUPAC name is ethane;methyl (4Z,5E)-1-acetyl-4,5-di(ethylidene)pyrrolidine-2-carboxylate.
Molecular Properties
| Compound Name | ethane;methyl (4Z,5E)-1-acetyl-4,5-di(ethylidene)pyrrolidine-2-carboxylate |
| PubChem CID | 142196399 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | ethane;methyl (4Z,5E)-1-acetyl-4,5-di(ethylidene)pyrrolidine-2-carboxylate |
| SMILES | C/C=C1/CC(C(=O)OC)N(C(C)=O)/C1=C/C.CC |
| InChI | InChI=1S/C12H17NO3.C2H6/c1-5-9-7-11(12(15)16-4)13(8(3)14)10(9)6-2;1-2/h5-6,11H,7H2,1-4H3;1-2H3/b9-5-,10-6+; |
| InChIKey | PLMCLQHKWQDSJT-KSTRYXAPSA-N |
| XLogP | 2.66 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;methyl (4Z,5E)-1-acetyl-4,5-di(ethylidene)pyrrolidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methyl (4Z,5E)-1-acetyl-4,5-di(ethylidene)pyrrolidine-2-carboxylate?
The IUPAC name of ethane;methyl (4Z,5E)-1-acetyl-4,5-di(ethylidene)pyrrolidine-2-carboxylate (CID 142196399) is ethane;methyl (4Z,5E)-1-acetyl-4,5-di(ethylidene)pyrrolidine-2-carboxylate.
What is the SMILES notation for ethane;methyl (4Z,5E)-1-acetyl-4,5-di(ethylidene)pyrrolidine-2-carboxylate?
The canonical SMILES for ethane;methyl (4Z,5E)-1-acetyl-4,5-di(ethylidene)pyrrolidine-2-carboxylate is C/C=C1/CC(C(=O)OC)N(C(C)=O)/C1=C/C.CC.
What is the InChIKey of ethane;methyl (4Z,5E)-1-acetyl-4,5-di(ethylidene)pyrrolidine-2-carboxylate?
The InChIKey is PLMCLQHKWQDSJT-KSTRYXAPSA-N. The full InChI is InChI=1S/C12H17NO3.C2H6/c1-5-9-7-11(12(15)16-4)13(8(3)14)10(9)6-2;1-2/h5-6,11H,7H2,1-4H3;1-2H3/b9-5-,10-6+;.
What are the key properties of ethane;methyl (4Z,5E)-1-acetyl-4,5-di(ethylidene)pyrrolidine-2-carboxylate?
ethane;methyl (4Z,5E)-1-acetyl-4,5-di(ethylidene)pyrrolidine-2-carboxylate has a molecular weight of 253.34 g/mol, XLogP of 2.66, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methyl (4Z,5E)-1-acetyl-4,5-di(ethylidene)pyrrolidine-2-carboxylate is sourced from PubChem (CID 142196399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).