C17H17IN4O4S — CID 142196719
ethyl 2-[(4-iodo-6,7-dimethoxyquinazolin-2-yl)amino]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 142196719) has the molecular formula C17H17IN4O4S and a molecular weight of 500.32 g/mol. Its IUPAC name is ethyl 2-[(4-iodo-6,7-dimethoxyquinazolin-2-yl)amino]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-[(4-iodo-6,7-dimethoxyquinazolin-2-yl)amino]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 142196719 |
| Molecular Formula | C17H17IN4O4S |
| Molecular Weight | 500.32 g/mol |
| Exact Mass | 500.00 |
| IUPAC Name | ethyl 2-[(4-iodo-6,7-dimethoxyquinazolin-2-yl)amino]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(Nc2nc(I)c3cc(OC)c(OC)cc3n2)nc1C |
| InChI | InChI=1S/C17H17IN4O4S/c1-5-26-15(23)13-8(2)19-17(27-13)22-16-20-10-7-12(25-4)11(24-3)6-9(10)14(18)21-16/h6-7H,5H2,1-4H3,(H,19,20,21,22) |
| InChIKey | GNHDLTFVQGAUQV-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 95.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.32 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|