C11H17F3O — CID 142198153
ethane;(3Z,5Z)-4-methyl-7-(trifluoromethoxy)hepta-1,3,5-triene (PubChem CID 142198153) has the molecular formula C11H17F3O and a molecular weight of 222.25 g/mol. Its IUPAC name is ethane;(3Z,5Z)-4-methyl-7-(trifluoromethoxy)hepta-1,3,5-triene.
| Compound Name | ethane;(3Z,5Z)-4-methyl-7-(trifluoromethoxy)hepta-1,3,5-triene |
|---|---|
| PubChem CID | 142198153 |
| Molecular Formula | C11H17F3O |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | ethane;(3Z,5Z)-4-methyl-7-(trifluoromethoxy)hepta-1,3,5-triene |
| SMILES | C=C/C=C(C)\C=C/COC(F)(F)F.CC |
| InChI | InChI=1S/C9H11F3O.C2H6/c1-3-5-8(2)6-4-7-13-9(10,11)12;1-2/h3-6H,1,7H2,2H3;1-2H3/b6-4-,8-5-; |
| InChIKey | QDOMQMZRXFLTAT-DFLGPFLZSA-N |
| XLogP | 4.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|