C32H28N4O3 — CID 142198186
1-cyclohexyl-N-oxo-2-[4-[(3-phenyl-2-pyridinyl)methoxy]phenyl]benzimidazole-5-carboxamide (PubChem CID 142198186) has the molecular formula C32H28N4O3 and a molecular weight of 516.60 g/mol. Its IUPAC name is 1-cyclohexyl-N-oxo-2-[4-[(3-phenyl-2-pyridinyl)methoxy]phenyl]benzimidazole-5-carboxamide.
| Compound Name | 1-cyclohexyl-N-oxo-2-[4-[(3-phenyl-2-pyridinyl)methoxy]phenyl]benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 142198186 |
| Molecular Formula | C32H28N4O3 |
| Molecular Weight | 516.60 g/mol |
| Exact Mass | 516.22 |
| IUPAC Name | 1-cyclohexyl-N-oxo-2-[4-[(3-phenyl-2-pyridinyl)methoxy]phenyl]benzimidazole-5-carboxamide |
| SMILES | O=NC(=O)c1ccc2c(c1)nc(-c1ccc(OCc3ncccc3-c3ccccc3)cc1)n2C1CCCCC1 |
| InChI | InChI=1S/C32H28N4O3/c37-32(35-38)24-15-18-30-28(20-24)34-31(36(30)25-10-5-2-6-11-25)23-13-16-26(17-14-23)39-21-29-27(12-7-19-33-29)22-8-3-1-4-9-22/h1,3-4,7-9,12-20,25H,2,5-6,10-11,21H2 |
| InChIKey | JPGJSPVHGQHEAR-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 86.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.60 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |