C37H36FN3O3S — CID 142198244
1-cyclohexyl-2-[2-fluoro-4-[[4-methyl-2-phenyl-5-(1,2-thiazolidin-2-yl)phenyl]methoxy]phenyl]benzimidazole-5-carboxylic acid (PubChem CID 142198244) has the molecular formula C37H36FN3O3S and a molecular weight of 621.78 g/mol. Its IUPAC name is 1-cyclohexyl-2-[2-fluoro-4-[[4-methyl-2-phenyl-5-(1,2-thiazolidin-2-yl)phenyl]methoxy]phenyl]benzimidazole-5-carboxylic acid.
| Compound Name | 1-cyclohexyl-2-[2-fluoro-4-[[4-methyl-2-phenyl-5-(1,2-thiazolidin-2-yl)phenyl]methoxy]phenyl]benzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 142198244 |
| Molecular Formula | C37H36FN3O3S |
| Molecular Weight | 621.78 g/mol |
| Exact Mass | 621.25 |
| IUPAC Name | 1-cyclohexyl-2-[2-fluoro-4-[[4-methyl-2-phenyl-5-(1,2-thiazolidin-2-yl)phenyl]methoxy]phenyl]benzimidazole-5-carboxylic acid |
| SMILES | Cc1cc(-c2ccccc2)c(COc2ccc(-c3nc4cc(C(=O)O)ccc4n3C3CCCCC3)c(F)c2)cc1N1CCCS1 |
| InChI | InChI=1S/C37H36FN3O3S/c1-24-19-31(25-9-4-2-5-10-25)27(21-35(24)40-17-8-18-45-40)23-44-29-14-15-30(32(38)22-29)36-39-33-20-26(37(42)43)13-16-34(33)41(36)28-11-6-3-7-12-28/h2,4-5,9-10,13-16,19-22,28H,3,6-8,11-12,17-18,23H2,1H3,(H,42,43) |
| InChIKey | DVZZDPLMNGRVOO-UHFFFAOYSA-N |
| XLogP | 9.46 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.78 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|