About ethylbenzene;2-(3-ethylphenyl)-1-hexan-3-ylbenzimidazole-5-carboxylic acid
ethylbenzene;2-(3-ethylphenyl)-1-hexan-3-ylbenzimidazole-5-carboxylic acid (PubChem CID 142198328) has the molecular formula C38H46N2O2
and a molecular weight of 562.80 g/mol. Its IUPAC name is ethylbenzene;2-(3-ethylphenyl)-1-hexan-3-ylbenzimidazole-5-carboxylic acid.
Molecular Properties
| Compound Name | ethylbenzene;2-(3-ethylphenyl)-1-hexan-3-ylbenzimidazole-5-carboxylic acid |
| PubChem CID | 142198328 |
| Molecular Formula | C38H46N2O2 |
| Molecular Weight | 562.80 g/mol |
| Exact Mass | 562.36 |
| IUPAC Name | ethylbenzene;2-(3-ethylphenyl)-1-hexan-3-ylbenzimidazole-5-carboxylic acid |
| SMILES | CCCC(CC)n1c(-c2cccc(CC)c2)nc2cc(C(=O)O)ccc21.CCc1ccccc1.CCc1ccccc1 |
| InChI | InChI=1S/C22H26N2O2.2C8H10/c1-4-8-18(6-3)24-20-12-11-17(22(25)26)14-19(20)23-21(24)16-10-7-9-15(5-2)13-16;2*1-2-8-6-4-3-5-7-8/h7,9-14,18H,4-6,8H2,1-3H3,(H,25,26);2*3-7H,2H2,1H3 |
| InChIKey | GVRJIWMGMWTBKV-UHFFFAOYSA-N |
| XLogP | 10.21 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 562.80 |
| LogP ≤ 5 | 10.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethylbenzene;2-(3-ethylphenyl)-1-hexan-3-ylbenzimidazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethylbenzene;2-(3-ethylphenyl)-1-hexan-3-ylbenzimidazole-5-carboxylic acid?
The IUPAC name of ethylbenzene;2-(3-ethylphenyl)-1-hexan-3-ylbenzimidazole-5-carboxylic acid (CID 142198328) is ethylbenzene;2-(3-ethylphenyl)-1-hexan-3-ylbenzimidazole-5-carboxylic acid.
What is the SMILES notation for ethylbenzene;2-(3-ethylphenyl)-1-hexan-3-ylbenzimidazole-5-carboxylic acid?
The canonical SMILES for ethylbenzene;2-(3-ethylphenyl)-1-hexan-3-ylbenzimidazole-5-carboxylic acid is CCCC(CC)n1c(-c2cccc(CC)c2)nc2cc(C(=O)O)ccc21.CCc1ccccc1.CCc1ccccc1.
What is the InChIKey of ethylbenzene;2-(3-ethylphenyl)-1-hexan-3-ylbenzimidazole-5-carboxylic acid?
The InChIKey is GVRJIWMGMWTBKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26N2O2.2C8H10/c1-4-8-18(6-3)24-20-12-11-17(22(25)26)14-19(20)23-21(24)16-10-7-9-15(5-2)13-16;2*1-2-8-6-4-3-5-7-8/h7,9-14,18H,4-6,8H2,1-3H3,(H,25,26);2*3-7H,2H2,1H3.
What are the key properties of ethylbenzene;2-(3-ethylphenyl)-1-hexan-3-ylbenzimidazole-5-carboxylic acid?
ethylbenzene;2-(3-ethylphenyl)-1-hexan-3-ylbenzimidazole-5-carboxylic acid has a molecular weight of 562.80 g/mol, XLogP of 10.21, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethylbenzene;2-(3-ethylphenyl)-1-hexan-3-ylbenzimidazole-5-carboxylic acid is sourced from PubChem (CID 142198328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).