C36H39N3O5S — CID 142198396
1-cyclohexyl-2-[4-[[2-methyl-4-[(2Z,7E)-9-oxonona-2,4,5,7-tetraen-4-yl]-1,3-thiazol-5-yl]methoxy]cyclohepta-1,3,5-trien-1-yl]benzimidazole-5-carboxylic acid;methanol (PubChem CID 142198396) has the molecular formula C36H39N3O5S and a molecular weight of 625.79 g/mol. Its IUPAC name is 1-cyclohexyl-2-[4-[[2-methyl-4-[(2Z,7E)-9-oxonona-2,4,5,7-tetraen-4-yl]-1,3-thiazol-5-yl]methoxy]cyclohepta-1,3,5-trien-1-yl]benzimidazole-5-carboxylic acid;methanol.
| Compound Name | 1-cyclohexyl-2-[4-[[2-methyl-4-[(2Z,7E)-9-oxonona-2,4,5,7-tetraen-4-yl]-1,3-thiazol-5-yl]methoxy]cyclohepta-1,3,5-trien-1-yl]benzimidazole-5-carboxylic acid;methanol |
|---|---|
| PubChem CID | 142198396 |
| Molecular Formula | C36H39N3O5S |
| Molecular Weight | 625.79 g/mol |
| Exact Mass | 625.26 |
| IUPAC Name | 1-cyclohexyl-2-[4-[[2-methyl-4-[(2Z,7E)-9-oxonona-2,4,5,7-tetraen-4-yl]-1,3-thiazol-5-yl]methoxy]cyclohepta-1,3,5-trien-1-yl]benzimidazole-5-carboxylic acid;methanol |
| SMILES | C/C=C\C(=C=C/C=C/C=O)c1nc(C)sc1COC1=CC=C(c2nc3cc(C(=O)O)ccc3n2C2CCCCC2)CC=C1.CO |
| InChI | InChI=1S/C35H35N3O4S.CH4O/c1-3-11-25(12-6-5-9-21-39)33-32(43-24(2)36-33)23-42-29-16-10-13-26(17-19-29)34-37-30-22-27(35(40)41)18-20-31(30)38(34)28-14-7-4-8-15-28;1-2/h3,5-6,9-11,16-22,28H,4,7-8,13-15,23H2,1-2H3,(H,40,41);2H,1H3/b9-5+,11-3-; |
| InChIKey | HPBHIUCAJUPEIN-FGOWWEPGSA-N |
| XLogP | 7.93 |
| TPSA | 114.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.79 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|