C35H35FN6O3 — CID 142198404
4-[2-[[4-[5-[(Z)-N-aminocarbamohydrazonoyl]-1-cyclohexylbenzimidazol-2-yl]-3-fluorophenoxy]methyl]-4-methylphenyl]benzoic acid (PubChem CID 142198404) has the molecular formula C35H35FN6O3 and a molecular weight of 606.70 g/mol. Its IUPAC name is 4-[2-[[4-[5-[(Z)-N-aminocarbamohydrazonoyl]-1-cyclohexylbenzimidazol-2-yl]-3-fluorophenoxy]methyl]-4-methylphenyl]benzoic acid.
| Compound Name | 4-[2-[[4-[5-[(Z)-N-aminocarbamohydrazonoyl]-1-cyclohexylbenzimidazol-2-yl]-3-fluorophenoxy]methyl]-4-methylphenyl]benzoic acid |
|---|---|
| PubChem CID | 142198404 |
| Molecular Formula | C35H35FN6O3 |
| Molecular Weight | 606.70 g/mol |
| Exact Mass | 606.28 |
| IUPAC Name | 4-[2-[[4-[5-[(Z)-N-aminocarbamohydrazonoyl]-1-cyclohexylbenzimidazol-2-yl]-3-fluorophenoxy]methyl]-4-methylphenyl]benzoic acid |
| SMILES | Cc1ccc(-c2ccc(C(=O)O)cc2)c(COc2ccc(-c3nc4cc(/C(=N/N)NN)ccc4n3C3CCCCC3)c(F)c2)c1 |
| InChI | InChI=1S/C35H35FN6O3/c1-21-7-14-28(22-8-10-23(11-9-22)35(43)44)25(17-21)20-45-27-13-15-29(30(36)19-27)34-39-31-18-24(33(40-37)41-38)12-16-32(31)42(34)26-5-3-2-4-6-26/h7-19,26H,2-6,20,37-38H2,1H3,(H,40,41)(H,43,44) |
| InChIKey | REFSVTRIYMCXBH-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 140.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.70 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|