About ethane;(1Z)-N-[(Z)-1-ethenylsulfanylprop-1-en-2-yl]-N-methylbuta-1,3-dien-1-amine
ethane;(1Z)-N-[(Z)-1-ethenylsulfanylprop-1-en-2-yl]-N-methylbuta-1,3-dien-1-amine (PubChem CID 142198480) has the molecular formula C12H21NS
and a molecular weight of 211.37 g/mol. Its IUPAC name is ethane;(1Z)-N-[(Z)-1-ethenylsulfanylprop-1-en-2-yl]-N-methylbuta-1,3-dien-1-amine.
Molecular Properties
| Compound Name | ethane;(1Z)-N-[(Z)-1-ethenylsulfanylprop-1-en-2-yl]-N-methylbuta-1,3-dien-1-amine |
| PubChem CID | 142198480 |
| Molecular Formula | C12H21NS |
| Molecular Weight | 211.37 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | ethane;(1Z)-N-[(Z)-1-ethenylsulfanylprop-1-en-2-yl]-N-methylbuta-1,3-dien-1-amine |
| SMILES | C=C/C=C\N(C)/C(C)=C\SC=C.CC |
| InChI | InChI=1S/C10H15NS.C2H6/c1-5-7-8-11(4)10(3)9-12-6-2;1-2/h5-9H,1-2H2,3-4H3;1-2H3/b8-7-,10-9-; |
| InChIKey | LDCZVSUTJRSOKX-CGGPWJJTSA-N |
| XLogP | 4.38 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.37 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;(1Z)-N-[(Z)-1-ethenylsulfanylprop-1-en-2-yl]-N-methylbuta-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(1Z)-N-[(Z)-1-ethenylsulfanylprop-1-en-2-yl]-N-methylbuta-1,3-dien-1-amine?
The IUPAC name of ethane;(1Z)-N-[(Z)-1-ethenylsulfanylprop-1-en-2-yl]-N-methylbuta-1,3-dien-1-amine (CID 142198480) is ethane;(1Z)-N-[(Z)-1-ethenylsulfanylprop-1-en-2-yl]-N-methylbuta-1,3-dien-1-amine.
What is the SMILES notation for ethane;(1Z)-N-[(Z)-1-ethenylsulfanylprop-1-en-2-yl]-N-methylbuta-1,3-dien-1-amine?
The canonical SMILES for ethane;(1Z)-N-[(Z)-1-ethenylsulfanylprop-1-en-2-yl]-N-methylbuta-1,3-dien-1-amine is C=C/C=C\N(C)/C(C)=C\SC=C.CC.
What is the InChIKey of ethane;(1Z)-N-[(Z)-1-ethenylsulfanylprop-1-en-2-yl]-N-methylbuta-1,3-dien-1-amine?
The InChIKey is LDCZVSUTJRSOKX-CGGPWJJTSA-N. The full InChI is InChI=1S/C10H15NS.C2H6/c1-5-7-8-11(4)10(3)9-12-6-2;1-2/h5-9H,1-2H2,3-4H3;1-2H3/b8-7-,10-9-;.
What are the key properties of ethane;(1Z)-N-[(Z)-1-ethenylsulfanylprop-1-en-2-yl]-N-methylbuta-1,3-dien-1-amine?
ethane;(1Z)-N-[(Z)-1-ethenylsulfanylprop-1-en-2-yl]-N-methylbuta-1,3-dien-1-amine has a molecular weight of 211.37 g/mol, XLogP of 4.38, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(1Z)-N-[(Z)-1-ethenylsulfanylprop-1-en-2-yl]-N-methylbuta-1,3-dien-1-amine is sourced from PubChem (CID 142198480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).