About pyridazine-4,5-diamine
pyridazine-4,5-diamine (PubChem CID 14219879) has the molecular formula C4H6N4
and a molecular weight of 110.12 g/mol. Its IUPAC name is pyridazine-4,5-diamine.
Molecular Properties
| Compound Name | pyridazine-4,5-diamine |
| PubChem CID | 14219879 |
| Molecular Formula | C4H6N4 |
| Molecular Weight | 110.12 g/mol |
| Exact Mass | 110.06 |
| IUPAC Name | pyridazine-4,5-diamine |
| SMILES | Nc1cnncc1N |
| InChI | InChI=1S/C4H6N4/c5-3-1-7-8-2-4(3)6/h1-2H,(H2,6,7)(H2,5,8) |
| InChIKey | CYCNSKOONFXROI-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.12 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze pyridazine-4,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridazine-4,5-diamine?
The IUPAC name of pyridazine-4,5-diamine (CID 14219879) is pyridazine-4,5-diamine.
What is the SMILES notation for pyridazine-4,5-diamine?
The canonical SMILES for pyridazine-4,5-diamine is Nc1cnncc1N.
What is the InChIKey of pyridazine-4,5-diamine?
The InChIKey is CYCNSKOONFXROI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N4/c5-3-1-7-8-2-4(3)6/h1-2H,(H2,6,7)(H2,5,8).
What are the key properties of pyridazine-4,5-diamine?
pyridazine-4,5-diamine has a molecular weight of 110.12 g/mol, XLogP of -0.36, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyridazine-4,5-diamine is sourced from PubChem (CID 14219879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).