About 1-(2-tert-butyl-3-pyrimidin-4-ylimidazo[1,2-a]pyridin-7-yl)-N,N-dimethylmethanamine
1-(2-tert-butyl-3-pyrimidin-4-ylimidazo[1,2-a]pyridin-7-yl)-N,N-dimethylmethanamine (PubChem CID 142198957) has the molecular formula C18H23N5
and a molecular weight of 309.42 g/mol. Its IUPAC name is 1-(2-tert-butyl-3-pyrimidin-4-ylimidazo[1,2-a]pyridin-7-yl)-N,N-dimethylmethanamine.
Molecular Properties
| Compound Name | 1-(2-tert-butyl-3-pyrimidin-4-ylimidazo[1,2-a]pyridin-7-yl)-N,N-dimethylmethanamine |
| PubChem CID | 142198957 |
| Molecular Formula | C18H23N5 |
| Molecular Weight | 309.42 g/mol |
| Exact Mass | 309.20 |
| IUPAC Name | 1-(2-tert-butyl-3-pyrimidin-4-ylimidazo[1,2-a]pyridin-7-yl)-N,N-dimethylmethanamine |
| SMILES | CN(C)Cc1ccn2c(-c3ccncn3)c(C(C)(C)C)nc2c1 |
| InChI | InChI=1S/C18H23N5/c1-18(2,3)17-16(14-6-8-19-12-20-14)23-9-7-13(11-22(4)5)10-15(23)21-17/h6-10,12H,11H2,1-5H3 |
| InChIKey | KPUAWEFLOOWFMG-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 46.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.42 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(2-tert-butyl-3-pyrimidin-4-ylimidazo[1,2-a]pyridin-7-yl)-N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-tert-butyl-3-pyrimidin-4-ylimidazo[1,2-a]pyridin-7-yl)-N,N-dimethylmethanamine?
The IUPAC name of 1-(2-tert-butyl-3-pyrimidin-4-ylimidazo[1,2-a]pyridin-7-yl)-N,N-dimethylmethanamine (CID 142198957) is 1-(2-tert-butyl-3-pyrimidin-4-ylimidazo[1,2-a]pyridin-7-yl)-N,N-dimethylmethanamine.
What is the SMILES notation for 1-(2-tert-butyl-3-pyrimidin-4-ylimidazo[1,2-a]pyridin-7-yl)-N,N-dimethylmethanamine?
The canonical SMILES for 1-(2-tert-butyl-3-pyrimidin-4-ylimidazo[1,2-a]pyridin-7-yl)-N,N-dimethylmethanamine is CN(C)Cc1ccn2c(-c3ccncn3)c(C(C)(C)C)nc2c1.
What is the InChIKey of 1-(2-tert-butyl-3-pyrimidin-4-ylimidazo[1,2-a]pyridin-7-yl)-N,N-dimethylmethanamine?
The InChIKey is KPUAWEFLOOWFMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23N5/c1-18(2,3)17-16(14-6-8-19-12-20-14)23-9-7-13(11-22(4)5)10-15(23)21-17/h6-10,12H,11H2,1-5H3.
What are the key properties of 1-(2-tert-butyl-3-pyrimidin-4-ylimidazo[1,2-a]pyridin-7-yl)-N,N-dimethylmethanamine?
1-(2-tert-butyl-3-pyrimidin-4-ylimidazo[1,2-a]pyridin-7-yl)-N,N-dimethylmethanamine has a molecular weight of 309.42 g/mol, XLogP of 3.15, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-tert-butyl-3-pyrimidin-4-ylimidazo[1,2-a]pyridin-7-yl)-N,N-dimethylmethanamine is sourced from PubChem (CID 142198957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).