C34H45F2N3O — CID 142199116
ethane;[3-[(1E,3E,4Z)-3-[1-[(5-fluorocyclohepta-1,6-dien-1-yl)methylamino]ethenylimino]-1-(4-fluorophenyl)-2-methylhexa-1,4-dienyl]iminocyclohexa-1,5-dien-1-yl]methanol (PubChem CID 142199116) has the molecular formula C34H45F2N3O and a molecular weight of 549.75 g/mol. Its IUPAC name is ethane;[3-[(1E,3E,4Z)-3-[1-[(5-fluorocyclohepta-1,6-dien-1-yl)methylamino]ethenylimino]-1-(4-fluorophenyl)-2-methylhexa-1,4-dienyl]iminocyclohexa-1,5-dien-1-yl]methanol.
| Compound Name | ethane;[3-[(1E,3E,4Z)-3-[1-[(5-fluorocyclohepta-1,6-dien-1-yl)methylamino]ethenylimino]-1-(4-fluorophenyl)-2-methylhexa-1,4-dienyl]iminocyclohexa-1,5-dien-1-yl]methanol |
|---|---|
| PubChem CID | 142199116 |
| Molecular Formula | C34H45F2N3O |
| Molecular Weight | 549.75 g/mol |
| Exact Mass | 549.35 |
| IUPAC Name | ethane;[3-[(1E,3E,4Z)-3-[1-[(5-fluorocyclohepta-1,6-dien-1-yl)methylamino]ethenylimino]-1-(4-fluorophenyl)-2-methylhexa-1,4-dienyl]iminocyclohexa-1,5-dien-1-yl]methanol |
| SMILES | C=C(/N=C(\C=C/C)C(/C)=C(/N=C1\C=C(CO)C=CC1)c1ccc(F)cc1)NCC1=CCCC(F)C=C1.CC.CC |
| InChI | InChI=1S/C30H33F2N3O.2C2H6/c1-4-7-29(34-22(3)33-19-23-8-5-10-26(31)15-12-23)21(2)30(25-13-16-27(32)17-14-25)35-28-11-6-9-24(18-28)20-36;2*1-2/h4,6-9,12-18,26,33,36H,3,5,10-11,19-20H2,1-2H3;2*1-2H3/b7-4-,30-21+,34-29+,35-28-;; |
| InChIKey | HWZPESZFSZWWIP-HZBRDWQTSA-N |
| XLogP | 8.62 |
| TPSA | 56.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.75 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|