C27H35N5O — CID 142199280
ethane;N-ethyl-4-[7-ethyl-2-(4-methylphenyl)imidazo[1,2-a]pyridin-3-yl]pyrimidin-2-amine;propanal (PubChem CID 142199280) has the molecular formula C27H35N5O and a molecular weight of 445.61 g/mol. Its IUPAC name is ethane;N-ethyl-4-[7-ethyl-2-(4-methylphenyl)imidazo[1,2-a]pyridin-3-yl]pyrimidin-2-amine;propanal.
| Compound Name | ethane;N-ethyl-4-[7-ethyl-2-(4-methylphenyl)imidazo[1,2-a]pyridin-3-yl]pyrimidin-2-amine;propanal |
|---|---|
| PubChem CID | 142199280 |
| Molecular Formula | C27H35N5O |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.28 |
| IUPAC Name | ethane;N-ethyl-4-[7-ethyl-2-(4-methylphenyl)imidazo[1,2-a]pyridin-3-yl]pyrimidin-2-amine;propanal |
| SMILES | CC.CCC=O.CCNc1nccc(-c2c(-c3ccc(C)cc3)nc3cc(CC)ccn23)n1 |
| InChI | InChI=1S/C22H23N5.C3H6O.C2H6/c1-4-16-11-13-27-19(14-16)26-20(17-8-6-15(3)7-9-17)21(27)18-10-12-24-22(25-18)23-5-2;1-2-3-4;1-2/h6-14H,4-5H2,1-3H3,(H,23,24,25);3H,2H2,1H3;1-2H3 |
| InChIKey | XWCICFDBUMIRCX-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|