About N-[(3E)-hexa-1,3,5-trien-3-yl]pyrimidin-2-amine
N-[(3E)-hexa-1,3,5-trien-3-yl]pyrimidin-2-amine (PubChem CID 142199521) has the molecular formula C10H11N3
and a molecular weight of 173.22 g/mol. Its IUPAC name is N-[(3E)-hexa-1,3,5-trien-3-yl]pyrimidin-2-amine.
Molecular Properties
| Compound Name | N-[(3E)-hexa-1,3,5-trien-3-yl]pyrimidin-2-amine |
| PubChem CID | 142199521 |
| Molecular Formula | C10H11N3 |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.10 |
| IUPAC Name | N-[(3E)-hexa-1,3,5-trien-3-yl]pyrimidin-2-amine |
| SMILES | C=C/C=C(\C=C)Nc1ncccn1 |
| InChI | InChI=1S/C10H11N3/c1-3-6-9(4-2)13-10-11-7-5-8-12-10/h3-8H,1-2H2,(H,11,12,13)/b9-6+ |
| InChIKey | WQCAGLFZIQAZMU-RMKNXTFCSA-N |
| XLogP | 2.14 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(3E)-hexa-1,3,5-trien-3-yl]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3E)-hexa-1,3,5-trien-3-yl]pyrimidin-2-amine?
The IUPAC name of N-[(3E)-hexa-1,3,5-trien-3-yl]pyrimidin-2-amine (CID 142199521) is N-[(3E)-hexa-1,3,5-trien-3-yl]pyrimidin-2-amine.
What is the SMILES notation for N-[(3E)-hexa-1,3,5-trien-3-yl]pyrimidin-2-amine?
The canonical SMILES for N-[(3E)-hexa-1,3,5-trien-3-yl]pyrimidin-2-amine is C=C/C=C(\C=C)Nc1ncccn1.
What is the InChIKey of N-[(3E)-hexa-1,3,5-trien-3-yl]pyrimidin-2-amine?
The InChIKey is WQCAGLFZIQAZMU-RMKNXTFCSA-N. The full InChI is InChI=1S/C10H11N3/c1-3-6-9(4-2)13-10-11-7-5-8-12-10/h3-8H,1-2H2,(H,11,12,13)/b9-6+.
What are the key properties of N-[(3E)-hexa-1,3,5-trien-3-yl]pyrimidin-2-amine?
N-[(3E)-hexa-1,3,5-trien-3-yl]pyrimidin-2-amine has a molecular weight of 173.22 g/mol, XLogP of 2.14, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3E)-hexa-1,3,5-trien-3-yl]pyrimidin-2-amine is sourced from PubChem (CID 142199521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).