About N-[2-(7,8-dimethoxy-6-methylnaphthalen-2-yl)ethyl]-N-ethylbutan-1-amine
N-[2-(7,8-dimethoxy-6-methylnaphthalen-2-yl)ethyl]-N-ethylbutan-1-amine (PubChem CID 142201229) has the molecular formula C21H31NO2
and a molecular weight of 329.48 g/mol. Its IUPAC name is N-[2-(7,8-dimethoxy-6-methylnaphthalen-2-yl)ethyl]-N-ethylbutan-1-amine.
Molecular Properties
| Compound Name | N-[2-(7,8-dimethoxy-6-methylnaphthalen-2-yl)ethyl]-N-ethylbutan-1-amine |
| PubChem CID | 142201229 |
| Molecular Formula | C21H31NO2 |
| Molecular Weight | 329.48 g/mol |
| Exact Mass | 329.24 |
| IUPAC Name | N-[2-(7,8-dimethoxy-6-methylnaphthalen-2-yl)ethyl]-N-ethylbutan-1-amine |
| SMILES | CCCCN(CC)CCc1ccc2cc(C)c(OC)c(OC)c2c1 |
| InChI | InChI=1S/C21H31NO2/c1-6-8-12-22(7-2)13-11-17-9-10-18-14-16(3)20(23-4)21(24-5)19(18)15-17/h9-10,14-15H,6-8,11-13H2,1-5H3 |
| InChIKey | LFILENOZGGDTAM-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.48 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[2-(7,8-dimethoxy-6-methylnaphthalen-2-yl)ethyl]-N-ethylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(7,8-dimethoxy-6-methylnaphthalen-2-yl)ethyl]-N-ethylbutan-1-amine?
The IUPAC name of N-[2-(7,8-dimethoxy-6-methylnaphthalen-2-yl)ethyl]-N-ethylbutan-1-amine (CID 142201229) is N-[2-(7,8-dimethoxy-6-methylnaphthalen-2-yl)ethyl]-N-ethylbutan-1-amine.
What is the SMILES notation for N-[2-(7,8-dimethoxy-6-methylnaphthalen-2-yl)ethyl]-N-ethylbutan-1-amine?
The canonical SMILES for N-[2-(7,8-dimethoxy-6-methylnaphthalen-2-yl)ethyl]-N-ethylbutan-1-amine is CCCCN(CC)CCc1ccc2cc(C)c(OC)c(OC)c2c1.
What is the InChIKey of N-[2-(7,8-dimethoxy-6-methylnaphthalen-2-yl)ethyl]-N-ethylbutan-1-amine?
The InChIKey is LFILENOZGGDTAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H31NO2/c1-6-8-12-22(7-2)13-11-17-9-10-18-14-16(3)20(23-4)21(24-5)19(18)15-17/h9-10,14-15H,6-8,11-13H2,1-5H3.
What are the key properties of N-[2-(7,8-dimethoxy-6-methylnaphthalen-2-yl)ethyl]-N-ethylbutan-1-amine?
N-[2-(7,8-dimethoxy-6-methylnaphthalen-2-yl)ethyl]-N-ethylbutan-1-amine has a molecular weight of 329.48 g/mol, XLogP of 4.83, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(7,8-dimethoxy-6-methylnaphthalen-2-yl)ethyl]-N-ethylbutan-1-amine is sourced from PubChem (CID 142201229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).