C19H21NO4 — CID 142201344
ethyl (E)-3-[2-(3,5-dimethoxy-4-methylphenyl)-4-pyridinyl]prop-2-enoate (PubChem CID 142201344) has the molecular formula C19H21NO4 and a molecular weight of 327.38 g/mol. Its IUPAC name is ethyl (E)-3-[2-(3,5-dimethoxy-4-methylphenyl)-4-pyridinyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[2-(3,5-dimethoxy-4-methylphenyl)-4-pyridinyl]prop-2-enoate |
|---|---|
| PubChem CID | 142201344 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | ethyl (E)-3-[2-(3,5-dimethoxy-4-methylphenyl)-4-pyridinyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1ccnc(-c2cc(OC)c(C)c(OC)c2)c1 |
| InChI | InChI=1S/C19H21NO4/c1-5-24-19(21)7-6-14-8-9-20-16(10-14)15-11-17(22-3)13(2)18(12-15)23-4/h6-12H,5H2,1-4H3/b7-6+ |
| InChIKey | IIDNTZILONUGPA-VOTSOKGWSA-N |
| XLogP | 3.65 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|