About 5-[2-(2,4-dichlorophenyl)pentan-2-yl]-1H-pyrazol-3-amine;ethane
5-[2-(2,4-dichlorophenyl)pentan-2-yl]-1H-pyrazol-3-amine;ethane (PubChem CID 142202790) has the molecular formula C16H23Cl2N3
and a molecular weight of 328.29 g/mol. Its IUPAC name is 5-[2-(2,4-dichlorophenyl)pentan-2-yl]-1H-pyrazol-3-amine;ethane.
Molecular Properties
| Compound Name | 5-[2-(2,4-dichlorophenyl)pentan-2-yl]-1H-pyrazol-3-amine;ethane |
| PubChem CID | 142202790 |
| Molecular Formula | C16H23Cl2N3 |
| Molecular Weight | 328.29 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 5-[2-(2,4-dichlorophenyl)pentan-2-yl]-1H-pyrazol-3-amine;ethane |
| SMILES | CC.CCCC(C)(c1cc(N)n[nH]1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H17Cl2N3.C2H6/c1-3-6-14(2,12-8-13(17)19-18-12)10-5-4-9(15)7-11(10)16;1-2/h4-5,7-8H,3,6H2,1-2H3,(H3,17,18,19);1-2H3 |
| InChIKey | GNOYMRJIALAKLV-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 328.29 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[2-(2,4-dichlorophenyl)pentan-2-yl]-1H-pyrazol-3-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(2,4-dichlorophenyl)pentan-2-yl]-1H-pyrazol-3-amine;ethane?
The IUPAC name of 5-[2-(2,4-dichlorophenyl)pentan-2-yl]-1H-pyrazol-3-amine;ethane (CID 142202790) is 5-[2-(2,4-dichlorophenyl)pentan-2-yl]-1H-pyrazol-3-amine;ethane.
What is the SMILES notation for 5-[2-(2,4-dichlorophenyl)pentan-2-yl]-1H-pyrazol-3-amine;ethane?
The canonical SMILES for 5-[2-(2,4-dichlorophenyl)pentan-2-yl]-1H-pyrazol-3-amine;ethane is CC.CCCC(C)(c1cc(N)n[nH]1)c1ccc(Cl)cc1Cl.
What is the InChIKey of 5-[2-(2,4-dichlorophenyl)pentan-2-yl]-1H-pyrazol-3-amine;ethane?
The InChIKey is GNOYMRJIALAKLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17Cl2N3.C2H6/c1-3-6-14(2,12-8-13(17)19-18-12)10-5-4-9(15)7-11(10)16;1-2/h4-5,7-8H,3,6H2,1-2H3,(H3,17,18,19);1-2H3.
What are the key properties of 5-[2-(2,4-dichlorophenyl)pentan-2-yl]-1H-pyrazol-3-amine;ethane?
5-[2-(2,4-dichlorophenyl)pentan-2-yl]-1H-pyrazol-3-amine;ethane has a molecular weight of 328.29 g/mol, XLogP of 5.43, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(2,4-dichlorophenyl)pentan-2-yl]-1H-pyrazol-3-amine;ethane is sourced from PubChem (CID 142202790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).