About ethoxymethylbenzene;5-[1-(4-methylphenyl)ethyl]-1H-pyrazol-3-amine
ethoxymethylbenzene;5-[1-(4-methylphenyl)ethyl]-1H-pyrazol-3-amine (PubChem CID 142202916) has the molecular formula C21H27N3O
and a molecular weight of 337.47 g/mol. Its IUPAC name is ethoxymethylbenzene;5-[1-(4-methylphenyl)ethyl]-1H-pyrazol-3-amine.
Molecular Properties
| Compound Name | ethoxymethylbenzene;5-[1-(4-methylphenyl)ethyl]-1H-pyrazol-3-amine |
| PubChem CID | 142202916 |
| Molecular Formula | C21H27N3O |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.22 |
| IUPAC Name | ethoxymethylbenzene;5-[1-(4-methylphenyl)ethyl]-1H-pyrazol-3-amine |
| SMILES | CCOCc1ccccc1.Cc1ccc(C(C)c2cc(N)n[nH]2)cc1 |
| InChI | InChI=1S/C12H15N3.C9H12O/c1-8-3-5-10(6-4-8)9(2)11-7-12(13)15-14-11;1-2-10-8-9-6-4-3-5-7-9/h3-7,9H,1-2H3,(H3,13,14,15);3-7H,2,8H2,1H3 |
| InChIKey | AQOKYUGVCFFKGP-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethoxymethylbenzene;5-[1-(4-methylphenyl)ethyl]-1H-pyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethoxymethylbenzene;5-[1-(4-methylphenyl)ethyl]-1H-pyrazol-3-amine?
The IUPAC name of ethoxymethylbenzene;5-[1-(4-methylphenyl)ethyl]-1H-pyrazol-3-amine (CID 142202916) is ethoxymethylbenzene;5-[1-(4-methylphenyl)ethyl]-1H-pyrazol-3-amine.
What is the SMILES notation for ethoxymethylbenzene;5-[1-(4-methylphenyl)ethyl]-1H-pyrazol-3-amine?
The canonical SMILES for ethoxymethylbenzene;5-[1-(4-methylphenyl)ethyl]-1H-pyrazol-3-amine is CCOCc1ccccc1.Cc1ccc(C(C)c2cc(N)n[nH]2)cc1.
What is the InChIKey of ethoxymethylbenzene;5-[1-(4-methylphenyl)ethyl]-1H-pyrazol-3-amine?
The InChIKey is AQOKYUGVCFFKGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3.C9H12O/c1-8-3-5-10(6-4-8)9(2)11-7-12(13)15-14-11;1-2-10-8-9-6-4-3-5-7-9/h3-7,9H,1-2H3,(H3,13,14,15);3-7H,2,8H2,1H3.
What are the key properties of ethoxymethylbenzene;5-[1-(4-methylphenyl)ethyl]-1H-pyrazol-3-amine?
ethoxymethylbenzene;5-[1-(4-methylphenyl)ethyl]-1H-pyrazol-3-amine has a molecular weight of 337.47 g/mol, XLogP of 4.68, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethoxymethylbenzene;5-[1-(4-methylphenyl)ethyl]-1H-pyrazol-3-amine is sourced from PubChem (CID 142202916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).