C14H21F3N2 — CID 142202920
1-[(3E,6E)-7-(trifluoromethyl)nona-1,3,6-trien-3-yl]piperazine (PubChem CID 142202920) has the molecular formula C14H21F3N2 and a molecular weight of 274.33 g/mol. Its IUPAC name is 1-[(3E,6E)-7-(trifluoromethyl)nona-1,3,6-trien-3-yl]piperazine.
| Compound Name | 1-[(3E,6E)-7-(trifluoromethyl)nona-1,3,6-trien-3-yl]piperazine |
|---|---|
| PubChem CID | 142202920 |
| Molecular Formula | C14H21F3N2 |
| Molecular Weight | 274.33 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 1-[(3E,6E)-7-(trifluoromethyl)nona-1,3,6-trien-3-yl]piperazine |
| SMILES | C=C/C(=C\C/C=C(\CC)C(F)(F)F)N1CCNCC1 |
| InChI | InChI=1S/C14H21F3N2/c1-3-12(14(15,16)17)6-5-7-13(4-2)19-10-8-18-9-11-19/h4,6-7,18H,2-3,5,8-11H2,1H3/b12-6+,13-7+ |
| InChIKey | OAKIBNSGFXYALT-PWHKKFIBSA-N |
| XLogP | 3.25 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.33 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|