C24H16O — CID 142203269
(4aZ,8aZ,12aZ,16aZ)-tetraphenylen-2-ol (PubChem CID 142203269) has the molecular formula C24H16O and a molecular weight of 320.39 g/mol. Its IUPAC name is (4aZ,8aZ,12aZ,16aZ)-tetraphenylen-2-ol.
| Compound Name | (4aZ,8aZ,12aZ,16aZ)-tetraphenylen-2-ol |
|---|---|
| PubChem CID | 142203269 |
| Molecular Formula | C24H16O |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | (4aZ,8aZ,12aZ,16aZ)-tetraphenylen-2-ol |
| SMILES | Oc1ccc2/c(c1)=c1/cccc/c1=c1\cccc\c1=c1/cccc/c1=2 |
| InChI | InChI=1S/C24H16O/c25-16-13-14-23-21-11-4-3-9-19(21)17-7-1-2-8-18(17)20-10-5-6-12-22(20)24(23)15-16/h1-15,25H/b19-17-,20-18-,23-21-,24-22- |
| InChIKey | ZMHSYWYTHKMOBA-LEYBOLSUSA-N |
| XLogP | 4.85 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |