C14H22N3O3+ — CID 142203347
[2-acetamido-5-(1-methylpiperidin-3-yl)oxyphenyl]-hydroxyazanium (PubChem CID 142203347) has the molecular formula C14H22N3O3+ and a molecular weight of 280.35 g/mol. Its IUPAC name is [2-acetamido-5-(1-methylpiperidin-3-yl)oxyphenyl]-hydroxyazanium.
| Compound Name | [2-acetamido-5-(1-methylpiperidin-3-yl)oxyphenyl]-hydroxyazanium |
|---|---|
| PubChem CID | 142203347 |
| Molecular Formula | C14H22N3O3+ |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | [2-acetamido-5-(1-methylpiperidin-3-yl)oxyphenyl]-hydroxyazanium |
| SMILES | CC(=O)Nc1ccc(OC2CCCN(C)C2)cc1[NH2+]O |
| InChI | InChI=1S/C14H21N3O3/c1-10(18)15-13-6-5-11(8-14(13)16-19)20-12-4-3-7-17(2)9-12/h5-6,8,12,16,19H,3-4,7,9H2,1-2H3,(H,15,18)/p+1 |
| InChIKey | SCPSERGBHBGETH-UHFFFAOYSA-O |
| XLogP | 0.70 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|