C31H39FN2O2 — CID 142203458
N-[3-[1-[3-(4-fluorophenyl)-3-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]oxypropyl]piperidin-4-yl]phenyl]-2-methylpropanamide (PubChem CID 142203458) has the molecular formula C31H39FN2O2 and a molecular weight of 490.66 g/mol. Its IUPAC name is N-[3-[1-[3-(4-fluorophenyl)-3-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]oxypropyl]piperidin-4-yl]phenyl]-2-methylpropanamide.
| Compound Name | N-[3-[1-[3-(4-fluorophenyl)-3-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]oxypropyl]piperidin-4-yl]phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 142203458 |
| Molecular Formula | C31H39FN2O2 |
| Molecular Weight | 490.66 g/mol |
| Exact Mass | 490.30 |
| IUPAC Name | N-[3-[1-[3-(4-fluorophenyl)-3-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]oxypropyl]piperidin-4-yl]phenyl]-2-methylpropanamide |
| SMILES | C=C(/C=C\C=C/C)OC(CCN1CCC(c2cccc(NC(=O)C(C)C)c2)CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C31H39FN2O2/c1-5-6-7-9-24(4)36-30(26-12-14-28(32)15-13-26)18-21-34-19-16-25(17-20-34)27-10-8-11-29(22-27)33-31(35)23(2)3/h5-15,22-23,25,30H,4,16-21H2,1-3H3,(H,33,35)/b6-5-,9-7- |
| InChIKey | AXZIAPFNKNGHHC-LZWBOMALSA-N |
| XLogP | 7.39 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.66 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|