C32H41FN2O2 — CID 142203540
N-[3-[1-[3-(4-fluorophenyl)-3-[(3Z)-6-methylhepta-1,3,5-trien-2-yl]oxypropyl]piperidin-4-yl]phenyl]-2-methylpropanamide (PubChem CID 142203540) has the molecular formula C32H41FN2O2 and a molecular weight of 504.69 g/mol. Its IUPAC name is N-[3-[1-[3-(4-fluorophenyl)-3-[(3Z)-6-methylhepta-1,3,5-trien-2-yl]oxypropyl]piperidin-4-yl]phenyl]-2-methylpropanamide.
| Compound Name | N-[3-[1-[3-(4-fluorophenyl)-3-[(3Z)-6-methylhepta-1,3,5-trien-2-yl]oxypropyl]piperidin-4-yl]phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 142203540 |
| Molecular Formula | C32H41FN2O2 |
| Molecular Weight | 504.69 g/mol |
| Exact Mass | 504.32 |
| IUPAC Name | N-[3-[1-[3-(4-fluorophenyl)-3-[(3Z)-6-methylhepta-1,3,5-trien-2-yl]oxypropyl]piperidin-4-yl]phenyl]-2-methylpropanamide |
| SMILES | C=C(/C=C\C=C(C)C)OC(CCN1CCC(c2cccc(NC(=O)C(C)C)c2)CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C32H41FN2O2/c1-23(2)8-6-9-25(5)37-31(27-12-14-29(33)15-13-27)18-21-35-19-16-26(17-20-35)28-10-7-11-30(22-28)34-32(36)24(3)4/h6-15,22,24,26,31H,5,16-21H2,1-4H3,(H,34,36)/b9-6- |
| InChIKey | WMUZEIPGKJGTRP-TWGQIWQCSA-N |
| XLogP | 7.78 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.69 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|