About N'-methyl-N'-[(5Z)-3-methyl-4-methylideneocta-5,7-dienyl]propane-1,3-diamine
N'-methyl-N'-[(5Z)-3-methyl-4-methylideneocta-5,7-dienyl]propane-1,3-diamine (PubChem CID 142203771) has the molecular formula C14H26N2
and a molecular weight of 222.38 g/mol. Its IUPAC name is N'-methyl-N'-[(5Z)-3-methyl-4-methylideneocta-5,7-dienyl]propane-1,3-diamine.
Molecular Properties
| Compound Name | N'-methyl-N'-[(5Z)-3-methyl-4-methylideneocta-5,7-dienyl]propane-1,3-diamine |
| PubChem CID | 142203771 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | N'-methyl-N'-[(5Z)-3-methyl-4-methylideneocta-5,7-dienyl]propane-1,3-diamine |
| SMILES | C=C/C=C\C(=C)C(C)CCN(C)CCCN |
| InChI | InChI=1S/C14H26N2/c1-5-6-8-13(2)14(3)9-12-16(4)11-7-10-15/h5-6,8,14H,1-2,7,9-12,15H2,3-4H3/b8-6- |
| InChIKey | ONEKQQJWPMFIMW-VURMDHGXSA-N |
| XLogP | 2.59 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N'-methyl-N'-[(5Z)-3-methyl-4-methylideneocta-5,7-dienyl]propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-methyl-N'-[(5Z)-3-methyl-4-methylideneocta-5,7-dienyl]propane-1,3-diamine?
The IUPAC name of N'-methyl-N'-[(5Z)-3-methyl-4-methylideneocta-5,7-dienyl]propane-1,3-diamine (CID 142203771) is N'-methyl-N'-[(5Z)-3-methyl-4-methylideneocta-5,7-dienyl]propane-1,3-diamine.
What is the SMILES notation for N'-methyl-N'-[(5Z)-3-methyl-4-methylideneocta-5,7-dienyl]propane-1,3-diamine?
The canonical SMILES for N'-methyl-N'-[(5Z)-3-methyl-4-methylideneocta-5,7-dienyl]propane-1,3-diamine is C=C/C=C\C(=C)C(C)CCN(C)CCCN.
What is the InChIKey of N'-methyl-N'-[(5Z)-3-methyl-4-methylideneocta-5,7-dienyl]propane-1,3-diamine?
The InChIKey is ONEKQQJWPMFIMW-VURMDHGXSA-N. The full InChI is InChI=1S/C14H26N2/c1-5-6-8-13(2)14(3)9-12-16(4)11-7-10-15/h5-6,8,14H,1-2,7,9-12,15H2,3-4H3/b8-6-.
What are the key properties of N'-methyl-N'-[(5Z)-3-methyl-4-methylideneocta-5,7-dienyl]propane-1,3-diamine?
N'-methyl-N'-[(5Z)-3-methyl-4-methylideneocta-5,7-dienyl]propane-1,3-diamine has a molecular weight of 222.38 g/mol, XLogP of 2.59, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-methyl-N'-[(5Z)-3-methyl-4-methylideneocta-5,7-dienyl]propane-1,3-diamine is sourced from PubChem (CID 142203771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).