About N-[(E)-hex-3-en-3-yl]-N'-[(3E)-penta-1,3-dien-3-yl]decanediamide
N-[(E)-hex-3-en-3-yl]-N'-[(3E)-penta-1,3-dien-3-yl]decanediamide (PubChem CID 142204504) has the molecular formula C21H36N2O2
and a molecular weight of 348.53 g/mol. Its IUPAC name is N-[(E)-hex-3-en-3-yl]-N'-[(3E)-penta-1,3-dien-3-yl]decanediamide.
Molecular Properties
| Compound Name | N-[(E)-hex-3-en-3-yl]-N'-[(3E)-penta-1,3-dien-3-yl]decanediamide |
| PubChem CID | 142204504 |
| Molecular Formula | C21H36N2O2 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.28 |
| IUPAC Name | N-[(E)-hex-3-en-3-yl]-N'-[(3E)-penta-1,3-dien-3-yl]decanediamide |
| SMILES | C=C/C(=C\C)NC(=O)CCCCCCCCC(=O)N/C(=C/CC)CC |
| InChI | InChI=1S/C21H36N2O2/c1-5-15-19(8-4)23-21(25)17-14-12-10-9-11-13-16-20(24)22-18(6-2)7-3/h6-7,15H,2,5,8-14,16-17H2,1,3-4H3,(H,22,24)(H,23,25)/b18-7+,19-15+ |
| InChIKey | BDUOZAPYNBIEGP-GZDKYGJJSA-N |
| XLogP | 5.13 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-hex-3-en-3-yl]-N'-[(3E)-penta-1,3-dien-3-yl]decanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-hex-3-en-3-yl]-N'-[(3E)-penta-1,3-dien-3-yl]decanediamide?
The IUPAC name of N-[(E)-hex-3-en-3-yl]-N'-[(3E)-penta-1,3-dien-3-yl]decanediamide (CID 142204504) is N-[(E)-hex-3-en-3-yl]-N'-[(3E)-penta-1,3-dien-3-yl]decanediamide.
What is the SMILES notation for N-[(E)-hex-3-en-3-yl]-N'-[(3E)-penta-1,3-dien-3-yl]decanediamide?
The canonical SMILES for N-[(E)-hex-3-en-3-yl]-N'-[(3E)-penta-1,3-dien-3-yl]decanediamide is C=C/C(=C\C)NC(=O)CCCCCCCCC(=O)N/C(=C/CC)CC.
What is the InChIKey of N-[(E)-hex-3-en-3-yl]-N'-[(3E)-penta-1,3-dien-3-yl]decanediamide?
The InChIKey is BDUOZAPYNBIEGP-GZDKYGJJSA-N. The full InChI is InChI=1S/C21H36N2O2/c1-5-15-19(8-4)23-21(25)17-14-12-10-9-11-13-16-20(24)22-18(6-2)7-3/h6-7,15H,2,5,8-14,16-17H2,1,3-4H3,(H,22,24)(H,23,25)/b18-7+,19-15+.
What are the key properties of N-[(E)-hex-3-en-3-yl]-N'-[(3E)-penta-1,3-dien-3-yl]decanediamide?
N-[(E)-hex-3-en-3-yl]-N'-[(3E)-penta-1,3-dien-3-yl]decanediamide has a molecular weight of 348.53 g/mol, XLogP of 5.13, 14 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-hex-3-en-3-yl]-N'-[(3E)-penta-1,3-dien-3-yl]decanediamide is sourced from PubChem (CID 142204504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).