C30H43N3O3 — CID 142204742
(E)-2-(aminomethylideneamino)-4-methyl-N-[8-(4-phenylmethoxyphenoxy)octyl]hept-4-enamide (PubChem CID 142204742) has the molecular formula C30H43N3O3 and a molecular weight of 493.69 g/mol. Its IUPAC name is (E)-2-(aminomethylideneamino)-4-methyl-N-[8-(4-phenylmethoxyphenoxy)octyl]hept-4-enamide.
| Compound Name | (E)-2-(aminomethylideneamino)-4-methyl-N-[8-(4-phenylmethoxyphenoxy)octyl]hept-4-enamide |
|---|---|
| PubChem CID | 142204742 |
| Molecular Formula | C30H43N3O3 |
| Molecular Weight | 493.69 g/mol |
| Exact Mass | 493.33 |
| IUPAC Name | (E)-2-(aminomethylideneamino)-4-methyl-N-[8-(4-phenylmethoxyphenoxy)octyl]hept-4-enamide |
| SMILES | CC/C=C(\C)CC(/N=C/N)C(=O)NCCCCCCCCOc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C30H43N3O3/c1-3-13-25(2)22-29(33-24-31)30(34)32-20-11-6-4-5-7-12-21-35-27-16-18-28(19-17-27)36-23-26-14-9-8-10-15-26/h8-10,13-19,24,29H,3-7,11-12,20-23H2,1-2H3,(H2,31,33)(H,32,34)/b25-13+ |
| InChIKey | HTLFBLMOAZNEPR-DHRITJCHSA-N |
| XLogP | 6.20 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.69 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|