C21H38N4O2S2 — CID 142205205
3-N'-(cycloheptanecarbothioyl)-1-N',1-N',3-N'-trimethylpropanedihydrazide;1-cyclopentylethanethione (PubChem CID 142205205) has the molecular formula C21H38N4O2S2 and a molecular weight of 442.70 g/mol. Its IUPAC name is 3-N'-(cycloheptanecarbothioyl)-1-N',1-N',3-N'-trimethylpropanedihydrazide;1-cyclopentylethanethione.
| Compound Name | 3-N'-(cycloheptanecarbothioyl)-1-N',1-N',3-N'-trimethylpropanedihydrazide;1-cyclopentylethanethione |
|---|---|
| PubChem CID | 142205205 |
| Molecular Formula | C21H38N4O2S2 |
| Molecular Weight | 442.70 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | 3-N'-(cycloheptanecarbothioyl)-1-N',1-N',3-N'-trimethylpropanedihydrazide;1-cyclopentylethanethione |
| SMILES | CC(=S)C1CCCC1.CN(C)NC(=O)CC(=O)NN(C)C(=S)C1CCCCCC1 |
| InChI | InChI=1S/C14H26N4O2S.C7H12S/c1-17(2)15-12(19)10-13(20)16-18(3)14(21)11-8-6-4-5-7-9-11;1-6(8)7-4-2-3-5-7/h11H,4-10H2,1-3H3,(H,15,19)(H,16,20);7H,2-5H2,1H3 |
| InChIKey | PTDGRRKYVWWMQC-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.70 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|