C10H15NS — CID 142205210
(2E,3Z)-2-ethylidene-N,N-dimethylhexa-3,5-dienethioamide (PubChem CID 142205210) has the molecular formula C10H15NS and a molecular weight of 181.30 g/mol. Its IUPAC name is (2E,3Z)-2-ethylidene-N,N-dimethylhexa-3,5-dienethioamide.
| Compound Name | (2E,3Z)-2-ethylidene-N,N-dimethylhexa-3,5-dienethioamide |
|---|---|
| PubChem CID | 142205210 |
| Molecular Formula | C10H15NS |
| Molecular Weight | 181.30 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | (2E,3Z)-2-ethylidene-N,N-dimethylhexa-3,5-dienethioamide |
| SMILES | C=C/C=C\C(=C/C)C(=S)N(C)C |
| InChI | InChI=1S/C10H15NS/c1-5-7-8-9(6-2)10(12)11(3)4/h5-8H,1H2,2-4H3/b8-7-,9-6+ |
| InChIKey | HGZMRTOMMFDKLI-SOKJVCRVSA-N |
| XLogP | 2.56 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.30 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|