C8H11NS — CID 142205251
N-methylcyclohexa-1,5-diene-1-carbothioamide (PubChem CID 142205251) has the molecular formula C8H11NS and a molecular weight of 153.25 g/mol. Its IUPAC name is N-methylcyclohexa-1,5-diene-1-carbothioamide.
| Compound Name | N-methylcyclohexa-1,5-diene-1-carbothioamide |
|---|---|
| PubChem CID | 142205251 |
| Molecular Formula | C8H11NS |
| Molecular Weight | 153.25 g/mol |
| Exact Mass | 153.06 |
| IUPAC Name | N-methylcyclohexa-1,5-diene-1-carbothioamide |
| SMILES | CNC(=S)C1=CCCC=C1 |
| InChI | InChI=1S/C8H11NS/c1-9-8(10)7-5-3-2-4-6-7/h3,5-6H,2,4H2,1H3,(H,9,10) |
| InChIKey | SSPOQHOEWSKJNO-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.25 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|