About 1-[(3R)-4,5-dimethyl-3-(2-methylpropyl)hexa-1,5-dien-2-yl]diazinane
1-[(3R)-4,5-dimethyl-3-(2-methylpropyl)hexa-1,5-dien-2-yl]diazinane (PubChem CID 142205317) has the molecular formula C16H30N2
and a molecular weight of 250.43 g/mol. Its IUPAC name is 1-[(3R)-4,5-dimethyl-3-(2-methylpropyl)hexa-1,5-dien-2-yl]diazinane.
Molecular Properties
| Compound Name | 1-[(3R)-4,5-dimethyl-3-(2-methylpropyl)hexa-1,5-dien-2-yl]diazinane |
| PubChem CID | 142205317 |
| Molecular Formula | C16H30N2 |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.24 |
| IUPAC Name | 1-[(3R)-4,5-dimethyl-3-(2-methylpropyl)hexa-1,5-dien-2-yl]diazinane |
| SMILES | C=C(C)C(C)[C@@H](CC(C)C)C(=C)N1CCCCN1 |
| InChI | InChI=1S/C16H30N2/c1-12(2)11-16(14(5)13(3)4)15(6)18-10-8-7-9-17-18/h12,14,16-17H,3,6-11H2,1-2,4-5H3/t14?,16-/m1/s1 |
| InChIKey | JFYHFTABEHNHKL-BZSJEYESSA-N |
| XLogP | 3.97 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3R)-4,5-dimethyl-3-(2-methylpropyl)hexa-1,5-dien-2-yl]diazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3R)-4,5-dimethyl-3-(2-methylpropyl)hexa-1,5-dien-2-yl]diazinane?
The IUPAC name of 1-[(3R)-4,5-dimethyl-3-(2-methylpropyl)hexa-1,5-dien-2-yl]diazinane (CID 142205317) is 1-[(3R)-4,5-dimethyl-3-(2-methylpropyl)hexa-1,5-dien-2-yl]diazinane.
What is the SMILES notation for 1-[(3R)-4,5-dimethyl-3-(2-methylpropyl)hexa-1,5-dien-2-yl]diazinane?
The canonical SMILES for 1-[(3R)-4,5-dimethyl-3-(2-methylpropyl)hexa-1,5-dien-2-yl]diazinane is C=C(C)C(C)[C@@H](CC(C)C)C(=C)N1CCCCN1.
What is the InChIKey of 1-[(3R)-4,5-dimethyl-3-(2-methylpropyl)hexa-1,5-dien-2-yl]diazinane?
The InChIKey is JFYHFTABEHNHKL-BZSJEYESSA-N. The full InChI is InChI=1S/C16H30N2/c1-12(2)11-16(14(5)13(3)4)15(6)18-10-8-7-9-17-18/h12,14,16-17H,3,6-11H2,1-2,4-5H3/t14?,16-/m1/s1.
What are the key properties of 1-[(3R)-4,5-dimethyl-3-(2-methylpropyl)hexa-1,5-dien-2-yl]diazinane?
1-[(3R)-4,5-dimethyl-3-(2-methylpropyl)hexa-1,5-dien-2-yl]diazinane has a molecular weight of 250.43 g/mol, XLogP of 3.97, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3R)-4,5-dimethyl-3-(2-methylpropyl)hexa-1,5-dien-2-yl]diazinane is sourced from PubChem (CID 142205317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).