About 2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid;propane
2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid;propane (PubChem CID 142205348) has the molecular formula C11H23NO5
and a molecular weight of 249.31 g/mol. Its IUPAC name is 2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid;propane.
Molecular Properties
| Compound Name | 2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid;propane |
| PubChem CID | 142205348 |
| Molecular Formula | C11H23NO5 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | 2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid;propane |
| SMILES | CC(C)(C)OC(=O)NCC(O)C(=O)O.CCC |
| InChI | InChI=1S/C8H15NO5.C3H8/c1-8(2,3)14-7(13)9-4-5(10)6(11)12;1-3-2/h5,10H,4H2,1-3H3,(H,9,13)(H,11,12);3H2,1-2H3 |
| InChIKey | FNXZXRBEORKUFA-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid;propane?
The IUPAC name of 2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid;propane (CID 142205348) is 2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid;propane.
What is the SMILES notation for 2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid;propane?
The canonical SMILES for 2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid;propane is CC(C)(C)OC(=O)NCC(O)C(=O)O.CCC.
What is the InChIKey of 2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid;propane?
The InChIKey is FNXZXRBEORKUFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO5.C3H8/c1-8(2,3)14-7(13)9-4-5(10)6(11)12;1-3-2/h5,10H,4H2,1-3H3,(H,9,13)(H,11,12);3H2,1-2H3.
What are the key properties of 2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid;propane?
2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid;propane has a molecular weight of 249.31 g/mol, XLogP of 1.37, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid;propane is sourced from PubChem (CID 142205348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).