C17H20F2N2O — CID 142205984
(4Z,6E)-6,8-difluoro-1-(6-methyl-4,5,6,7-tetrahydro-1H-benzimidazol-2-yl)nona-4,6,8-trien-2-one (PubChem CID 142205984) has the molecular formula C17H20F2N2O and a molecular weight of 306.36 g/mol. Its IUPAC name is (4Z,6E)-6,8-difluoro-1-(6-methyl-4,5,6,7-tetrahydro-1H-benzimidazol-2-yl)nona-4,6,8-trien-2-one.
| Compound Name | (4Z,6E)-6,8-difluoro-1-(6-methyl-4,5,6,7-tetrahydro-1H-benzimidazol-2-yl)nona-4,6,8-trien-2-one |
|---|---|
| PubChem CID | 142205984 |
| Molecular Formula | C17H20F2N2O |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | (4Z,6E)-6,8-difluoro-1-(6-methyl-4,5,6,7-tetrahydro-1H-benzimidazol-2-yl)nona-4,6,8-trien-2-one |
| SMILES | C=C(F)/C=C(F)\C=C/CC(=O)Cc1nc2c([nH]1)CC(C)CC2 |
| InChI | InChI=1S/C17H20F2N2O/c1-11-6-7-15-16(8-11)21-17(20-15)10-14(22)5-3-4-13(19)9-12(2)18/h3-4,9,11H,2,5-8,10H2,1H3,(H,20,21)/b4-3-,13-9+ |
| InChIKey | CJHFRIBVFSOPGR-VGMAVWSOSA-N |
| XLogP | 3.93 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|