About 2-[(3E)-hexa-1,3,5-trien-3-yl]-6-methyl-4-phenylphenol
2-[(3E)-hexa-1,3,5-trien-3-yl]-6-methyl-4-phenylphenol (PubChem CID 142206272) has the molecular formula C19H18O
and a molecular weight of 262.35 g/mol. Its IUPAC name is 2-[(3E)-hexa-1,3,5-trien-3-yl]-6-methyl-4-phenylphenol.
Molecular Properties
| Compound Name | 2-[(3E)-hexa-1,3,5-trien-3-yl]-6-methyl-4-phenylphenol |
| PubChem CID | 142206272 |
| Molecular Formula | C19H18O |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 2-[(3E)-hexa-1,3,5-trien-3-yl]-6-methyl-4-phenylphenol |
| SMILES | C=C/C=C(\C=C)c1cc(-c2ccccc2)cc(C)c1O |
| InChI | InChI=1S/C19H18O/c1-4-9-15(5-2)18-13-17(12-14(3)19(18)20)16-10-7-6-8-11-16/h4-13,20H,1-2H2,3H3/b15-9+ |
| InChIKey | OLPDUGJNIVWFMD-OQLLNIDSSA-N |
| XLogP | 5.12 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3E)-hexa-1,3,5-trien-3-yl]-6-methyl-4-phenylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3E)-hexa-1,3,5-trien-3-yl]-6-methyl-4-phenylphenol?
The IUPAC name of 2-[(3E)-hexa-1,3,5-trien-3-yl]-6-methyl-4-phenylphenol (CID 142206272) is 2-[(3E)-hexa-1,3,5-trien-3-yl]-6-methyl-4-phenylphenol.
What is the SMILES notation for 2-[(3E)-hexa-1,3,5-trien-3-yl]-6-methyl-4-phenylphenol?
The canonical SMILES for 2-[(3E)-hexa-1,3,5-trien-3-yl]-6-methyl-4-phenylphenol is C=C/C=C(\C=C)c1cc(-c2ccccc2)cc(C)c1O.
What is the InChIKey of 2-[(3E)-hexa-1,3,5-trien-3-yl]-6-methyl-4-phenylphenol?
The InChIKey is OLPDUGJNIVWFMD-OQLLNIDSSA-N. The full InChI is InChI=1S/C19H18O/c1-4-9-15(5-2)18-13-17(12-14(3)19(18)20)16-10-7-6-8-11-16/h4-13,20H,1-2H2,3H3/b15-9+.
What are the key properties of 2-[(3E)-hexa-1,3,5-trien-3-yl]-6-methyl-4-phenylphenol?
2-[(3E)-hexa-1,3,5-trien-3-yl]-6-methyl-4-phenylphenol has a molecular weight of 262.35 g/mol, XLogP of 5.12, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3E)-hexa-1,3,5-trien-3-yl]-6-methyl-4-phenylphenol is sourced from PubChem (CID 142206272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).