About ethenyl 3-(1,1-difluoroethyl)-N-(3-fluoro-2-methylphenyl)benzenecarboximidate;fluoromethane
ethenyl 3-(1,1-difluoroethyl)-N-(3-fluoro-2-methylphenyl)benzenecarboximidate;fluoromethane (PubChem CID 142206335) has the molecular formula C19H19F4NO
and a molecular weight of 353.36 g/mol. Its IUPAC name is ethenyl 3-(1,1-difluoroethyl)-N-(3-fluoro-2-methylphenyl)benzenecarboximidate;fluoromethane.
Molecular Properties
| Compound Name | ethenyl 3-(1,1-difluoroethyl)-N-(3-fluoro-2-methylphenyl)benzenecarboximidate;fluoromethane |
| PubChem CID | 142206335 |
| Molecular Formula | C19H19F4NO |
| Molecular Weight | 353.36 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | ethenyl 3-(1,1-difluoroethyl)-N-(3-fluoro-2-methylphenyl)benzenecarboximidate;fluoromethane |
| SMILES | C=CO/C(=N\c1cccc(F)c1C)c1cccc(C(C)(F)F)c1.CF |
| InChI | InChI=1S/C18H16F3NO.CH3F/c1-4-23-17(22-16-10-6-9-15(19)12(16)2)13-7-5-8-14(11-13)18(3,20)21;1-2/h4-11H,1H2,2-3H3;1H3/b22-17-; |
| InChIKey | LELPQDMRPUUQSF-JJECXDOKSA-N |
| XLogP | 6.07 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 353.36 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethenyl 3-(1,1-difluoroethyl)-N-(3-fluoro-2-methylphenyl)benzenecarboximidate;fluoromethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenyl 3-(1,1-difluoroethyl)-N-(3-fluoro-2-methylphenyl)benzenecarboximidate;fluoromethane?
The IUPAC name of ethenyl 3-(1,1-difluoroethyl)-N-(3-fluoro-2-methylphenyl)benzenecarboximidate;fluoromethane (CID 142206335) is ethenyl 3-(1,1-difluoroethyl)-N-(3-fluoro-2-methylphenyl)benzenecarboximidate;fluoromethane.
What is the SMILES notation for ethenyl 3-(1,1-difluoroethyl)-N-(3-fluoro-2-methylphenyl)benzenecarboximidate;fluoromethane?
The canonical SMILES for ethenyl 3-(1,1-difluoroethyl)-N-(3-fluoro-2-methylphenyl)benzenecarboximidate;fluoromethane is C=CO/C(=N\c1cccc(F)c1C)c1cccc(C(C)(F)F)c1.CF.
What is the InChIKey of ethenyl 3-(1,1-difluoroethyl)-N-(3-fluoro-2-methylphenyl)benzenecarboximidate;fluoromethane?
The InChIKey is LELPQDMRPUUQSF-JJECXDOKSA-N. The full InChI is InChI=1S/C18H16F3NO.CH3F/c1-4-23-17(22-16-10-6-9-15(19)12(16)2)13-7-5-8-14(11-13)18(3,20)21;1-2/h4-11H,1H2,2-3H3;1H3/b22-17-;.
What are the key properties of ethenyl 3-(1,1-difluoroethyl)-N-(3-fluoro-2-methylphenyl)benzenecarboximidate;fluoromethane?
ethenyl 3-(1,1-difluoroethyl)-N-(3-fluoro-2-methylphenyl)benzenecarboximidate;fluoromethane has a molecular weight of 353.36 g/mol, XLogP of 6.07, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethenyl 3-(1,1-difluoroethyl)-N-(3-fluoro-2-methylphenyl)benzenecarboximidate;fluoromethane is sourced from PubChem (CID 142206335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).