C15H17NS — CID 142206918
N-[(E)-2-(4-methylcyclohepta-1,3,5,6-tetraen-1-yl)sulfanylbut-2-enyl]prop-2-en-1-imine (PubChem CID 142206918) has the molecular formula C15H17NS and a molecular weight of 243.37 g/mol. Its IUPAC name is N-[(E)-2-(4-methylcyclohepta-1,3,5,6-tetraen-1-yl)sulfanylbut-2-enyl]prop-2-en-1-imine.
| Compound Name | N-[(E)-2-(4-methylcyclohepta-1,3,5,6-tetraen-1-yl)sulfanylbut-2-enyl]prop-2-en-1-imine |
|---|---|
| PubChem CID | 142206918 |
| Molecular Formula | C15H17NS |
| Molecular Weight | 243.37 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | N-[(E)-2-(4-methylcyclohepta-1,3,5,6-tetraen-1-yl)sulfanylbut-2-enyl]prop-2-en-1-imine |
| SMILES | C=C/C=N/C/C(=C\C)SC1=CC=C(C)C=C=C1 |
| InChI | InChI=1S/C15H17NS/c1-4-11-16-12-14(5-2)17-15-8-6-7-13(3)9-10-15/h4-5,7-11H,1,12H2,2-3H3/b14-5+,16-11+ |
| InChIKey | DMUUJNYRYHFZPF-UNNIAFHBSA-N |
| XLogP | 4.44 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.37 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|