About N-(4-methylcyclohepta-1,3,6-trien-1-yl)formamide
N-(4-methylcyclohepta-1,3,6-trien-1-yl)formamide (PubChem CID 142207223) has the molecular formula C9H11NO
and a molecular weight of 149.19 g/mol. Its IUPAC name is N-(4-methylcyclohepta-1,3,6-trien-1-yl)formamide.
Molecular Properties
| Compound Name | N-(4-methylcyclohepta-1,3,6-trien-1-yl)formamide |
| PubChem CID | 142207223 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | N-(4-methylcyclohepta-1,3,6-trien-1-yl)formamide |
| SMILES | CC1=CC=C(NC=O)C=CC1 |
| InChI | InChI=1S/C9H11NO/c1-8-3-2-4-9(6-5-8)10-7-11/h2,4-7H,3H2,1H3,(H,10,11) |
| InChIKey | QMBPIXXREOXWPP-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-(4-methylcyclohepta-1,3,6-trien-1-yl)formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-methylcyclohepta-1,3,6-trien-1-yl)formamide?
The IUPAC name of N-(4-methylcyclohepta-1,3,6-trien-1-yl)formamide (CID 142207223) is N-(4-methylcyclohepta-1,3,6-trien-1-yl)formamide.
What is the SMILES notation for N-(4-methylcyclohepta-1,3,6-trien-1-yl)formamide?
The canonical SMILES for N-(4-methylcyclohepta-1,3,6-trien-1-yl)formamide is CC1=CC=C(NC=O)C=CC1.
What is the InChIKey of N-(4-methylcyclohepta-1,3,6-trien-1-yl)formamide?
The InChIKey is QMBPIXXREOXWPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO/c1-8-3-2-4-9(6-5-8)10-7-11/h2,4-7H,3H2,1H3,(H,10,11).
What are the key properties of N-(4-methylcyclohepta-1,3,6-trien-1-yl)formamide?
N-(4-methylcyclohepta-1,3,6-trien-1-yl)formamide has a molecular weight of 149.19 g/mol, XLogP of 1.52, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-methylcyclohepta-1,3,6-trien-1-yl)formamide is sourced from PubChem (CID 142207223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).