About N-ethylidene-N'-(3-methylbut-1-en-2-yl)methanimidamide
N-ethylidene-N'-(3-methylbut-1-en-2-yl)methanimidamide (PubChem CID 142207625) has the molecular formula C8H14N2
and a molecular weight of 138.21 g/mol. Its IUPAC name is N-ethylidene-N'-(3-methylbut-1-en-2-yl)methanimidamide.
Molecular Properties
| Compound Name | N-ethylidene-N'-(3-methylbut-1-en-2-yl)methanimidamide |
| PubChem CID | 142207625 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | N-ethylidene-N'-(3-methylbut-1-en-2-yl)methanimidamide |
| SMILES | C=C(/N=C/N=C/C)C(C)C |
| InChI | InChI=1S/C8H14N2/c1-5-9-6-10-8(4)7(2)3/h5-7H,4H2,1-3H3/b9-5+,10-6+ |
| InChIKey | GEPHLBARCRUSRL-NXZHAISVSA-N |
| XLogP | 2.28 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-ethylidene-N'-(3-methylbut-1-en-2-yl)methanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethylidene-N'-(3-methylbut-1-en-2-yl)methanimidamide?
The IUPAC name of N-ethylidene-N'-(3-methylbut-1-en-2-yl)methanimidamide (CID 142207625) is N-ethylidene-N'-(3-methylbut-1-en-2-yl)methanimidamide.
What is the SMILES notation for N-ethylidene-N'-(3-methylbut-1-en-2-yl)methanimidamide?
The canonical SMILES for N-ethylidene-N'-(3-methylbut-1-en-2-yl)methanimidamide is C=C(/N=C/N=C/C)C(C)C.
What is the InChIKey of N-ethylidene-N'-(3-methylbut-1-en-2-yl)methanimidamide?
The InChIKey is GEPHLBARCRUSRL-NXZHAISVSA-N. The full InChI is InChI=1S/C8H14N2/c1-5-9-6-10-8(4)7(2)3/h5-7H,4H2,1-3H3/b9-5+,10-6+.
What are the key properties of N-ethylidene-N'-(3-methylbut-1-en-2-yl)methanimidamide?
N-ethylidene-N'-(3-methylbut-1-en-2-yl)methanimidamide has a molecular weight of 138.21 g/mol, XLogP of 2.28, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethylidene-N'-(3-methylbut-1-en-2-yl)methanimidamide is sourced from PubChem (CID 142207625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).