ethane;1-ethyl-5-propan-2-ylindole-2-carboxylic acid

C16H23NO2 — CID 142207725

IUPACethane;1-ethyl-5-propan-2-ylindole-2-carboxylic acid
SMILESCC.CCn1c(C(=O)O)cc2cc(C(C)C)ccc21
InChIInChI=1S/C14H17NO2.C2H6/c1-4-15-12-6-5-10(9(2)3)7-11(12)8-13(15)14(16)17;1-2/h5-9H,4H2,1-3H3,(H,16,17);1-2H3
InChIKeySQFROAFTHWCIAU-UHFFFAOYSA-N
MW261.36 g/mol
LogP4.51
Rot. Bonds3

About ethane;1-ethyl-5-propan-2-ylindole-2-carboxylic acid

ethane;1-ethyl-5-propan-2-ylindole-2-carboxylic acid (PubChem CID 142207725) has the molecular formula C16H23NO2 and a molecular weight of 261.36 g/mol. Its IUPAC name is ethane;1-ethyl-5-propan-2-ylindole-2-carboxylic acid.

Molecular Properties

Compound Nameethane;1-ethyl-5-propan-2-ylindole-2-carboxylic acid
PubChem CID142207725
Molecular FormulaC16H23NO2
Molecular Weight261.36 g/mol
Exact Mass261.17
IUPAC Nameethane;1-ethyl-5-propan-2-ylindole-2-carboxylic acid
SMILESCC.CCn1c(C(=O)O)cc2cc(C(C)C)ccc21
InChIInChI=1S/C14H17NO2.C2H6/c1-4-15-12-6-5-10(9(2)3)7-11(12)8-13(15)14(16)17;1-2/h5-9H,4H2,1-3H3,(H,16,17);1-2H3
InChIKeySQFROAFTHWCIAU-UHFFFAOYSA-N
XLogP4.51
TPSA42.23 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500261.36
LogP ≤ 54.51
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze ethane;1-ethyl-5-propan-2-ylindole-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethane;1-ethyl-5-propan-2-ylindole-2-carboxylic acid?
The IUPAC name of ethane;1-ethyl-5-propan-2-ylindole-2-carboxylic acid (CID 142207725) is ethane;1-ethyl-5-propan-2-ylindole-2-carboxylic acid.
What is the SMILES notation for ethane;1-ethyl-5-propan-2-ylindole-2-carboxylic acid?
The canonical SMILES for ethane;1-ethyl-5-propan-2-ylindole-2-carboxylic acid is CC.CCn1c(C(=O)O)cc2cc(C(C)C)ccc21.
What is the InChIKey of ethane;1-ethyl-5-propan-2-ylindole-2-carboxylic acid?
The InChIKey is SQFROAFTHWCIAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO2.C2H6/c1-4-15-12-6-5-10(9(2)3)7-11(12)8-13(15)14(16)17;1-2/h5-9H,4H2,1-3H3,(H,16,17);1-2H3.
What are the key properties of ethane;1-ethyl-5-propan-2-ylindole-2-carboxylic acid?
ethane;1-ethyl-5-propan-2-ylindole-2-carboxylic acid has a molecular weight of 261.36 g/mol, XLogP of 4.51, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-ethyl-5-propan-2-ylindole-2-carboxylic acid is sourced from PubChem (CID 142207725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).