About ethane;[1-(2-hydroxyethylamino)-1-oxopropan-2-yl] methanedithioate
ethane;[1-(2-hydroxyethylamino)-1-oxopropan-2-yl] methanedithioate (PubChem CID 142207995) has the molecular formula C8H17NO2S2
and a molecular weight of 223.36 g/mol. Its IUPAC name is ethane;[1-(2-hydroxyethylamino)-1-oxopropan-2-yl] methanedithioate.
Molecular Properties
| Compound Name | ethane;[1-(2-hydroxyethylamino)-1-oxopropan-2-yl] methanedithioate |
| PubChem CID | 142207995 |
| Molecular Formula | C8H17NO2S2 |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | ethane;[1-(2-hydroxyethylamino)-1-oxopropan-2-yl] methanedithioate |
| SMILES | CC.CC(SC=S)C(=O)NCCO |
| InChI | InChI=1S/C6H11NO2S2.C2H6/c1-5(11-4-10)6(9)7-2-3-8;1-2/h4-5,8H,2-3H2,1H3,(H,7,9);1-2H3 |
| InChIKey | POLRTNDXFRAZNI-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze ethane;[1-(2-hydroxyethylamino)-1-oxopropan-2-yl] methanedithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;[1-(2-hydroxyethylamino)-1-oxopropan-2-yl] methanedithioate?
The IUPAC name of ethane;[1-(2-hydroxyethylamino)-1-oxopropan-2-yl] methanedithioate (CID 142207995) is ethane;[1-(2-hydroxyethylamino)-1-oxopropan-2-yl] methanedithioate.
What is the SMILES notation for ethane;[1-(2-hydroxyethylamino)-1-oxopropan-2-yl] methanedithioate?
The canonical SMILES for ethane;[1-(2-hydroxyethylamino)-1-oxopropan-2-yl] methanedithioate is CC.CC(SC=S)C(=O)NCCO.
What is the InChIKey of ethane;[1-(2-hydroxyethylamino)-1-oxopropan-2-yl] methanedithioate?
The InChIKey is POLRTNDXFRAZNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO2S2.C2H6/c1-5(11-4-10)6(9)7-2-3-8;1-2/h4-5,8H,2-3H2,1H3,(H,7,9);1-2H3.
What are the key properties of ethane;[1-(2-hydroxyethylamino)-1-oxopropan-2-yl] methanedithioate?
ethane;[1-(2-hydroxyethylamino)-1-oxopropan-2-yl] methanedithioate has a molecular weight of 223.36 g/mol, XLogP of 1.20, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;[1-(2-hydroxyethylamino)-1-oxopropan-2-yl] methanedithioate is sourced from PubChem (CID 142207995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).