C15H20FN3O — CID 142208031
N-[(3Z,5Z)-2,3-dimethylhepta-1,3,5-trien-4-yl]-5-fluoro-1,3-dimethylpyrazole-4-carboxamide (PubChem CID 142208031) has the molecular formula C15H20FN3O and a molecular weight of 277.34 g/mol. Its IUPAC name is N-[(3Z,5Z)-2,3-dimethylhepta-1,3,5-trien-4-yl]-5-fluoro-1,3-dimethylpyrazole-4-carboxamide.
| Compound Name | N-[(3Z,5Z)-2,3-dimethylhepta-1,3,5-trien-4-yl]-5-fluoro-1,3-dimethylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 142208031 |
| Molecular Formula | C15H20FN3O |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | N-[(3Z,5Z)-2,3-dimethylhepta-1,3,5-trien-4-yl]-5-fluoro-1,3-dimethylpyrazole-4-carboxamide |
| SMILES | C=C(C)/C(C)=C(/C=C\C)NC(=O)c1c(C)nn(C)c1F |
| InChI | InChI=1S/C15H20FN3O/c1-7-8-12(10(4)9(2)3)17-15(20)13-11(5)18-19(6)14(13)16/h7-8H,2H2,1,3-6H3,(H,17,20)/b8-7-,12-10- |
| InChIKey | FLWBZBXRXKRASL-ZMBXXGKISA-N |
| XLogP | 3.02 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|