C15H26O — CID 142208270
(2E,4E,6E)-5-tert-butyl-8,8-dimethylnona-2,4,6-trien-2-ol (PubChem CID 142208270) has the molecular formula C15H26O and a molecular weight of 222.37 g/mol. Its IUPAC name is (2E,4E,6E)-5-tert-butyl-8,8-dimethylnona-2,4,6-trien-2-ol.
| Compound Name | (2E,4E,6E)-5-tert-butyl-8,8-dimethylnona-2,4,6-trien-2-ol |
|---|---|
| PubChem CID | 142208270 |
| Molecular Formula | C15H26O |
| Molecular Weight | 222.37 g/mol |
| Exact Mass | 222.20 |
| IUPAC Name | (2E,4E,6E)-5-tert-butyl-8,8-dimethylnona-2,4,6-trien-2-ol |
| SMILES | C/C(O)=C\C=C(/C=C/C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C15H26O/c1-12(16)8-9-13(15(5,6)7)10-11-14(2,3)4/h8-11,16H,1-7H3/b11-10+,12-8+,13-9+ |
| InChIKey | UKELUTHZHAKZPQ-SQYYMOODSA-N |
| XLogP | 5.02 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.37 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|