C27H43NO2 — CID 142209251
N-(4-butanoylcyclohexyl)-N-methyl-2-(4-phenylcyclohexyl)acetamide;ethane (PubChem CID 142209251) has the molecular formula C27H43NO2 and a molecular weight of 413.65 g/mol. Its IUPAC name is N-(4-butanoylcyclohexyl)-N-methyl-2-(4-phenylcyclohexyl)acetamide;ethane.
| Compound Name | N-(4-butanoylcyclohexyl)-N-methyl-2-(4-phenylcyclohexyl)acetamide;ethane |
|---|---|
| PubChem CID | 142209251 |
| Molecular Formula | C27H43NO2 |
| Molecular Weight | 413.65 g/mol |
| Exact Mass | 413.33 |
| IUPAC Name | N-(4-butanoylcyclohexyl)-N-methyl-2-(4-phenylcyclohexyl)acetamide;ethane |
| SMILES | CC.CCCC(=O)C1CCC(N(C)C(=O)CC2CCC(c3ccccc3)CC2)CC1 |
| InChI | InChI=1S/C25H37NO2.C2H6/c1-3-7-24(27)22-14-16-23(17-15-22)26(2)25(28)18-19-10-12-21(13-11-19)20-8-5-4-6-9-20;1-2/h4-6,8-9,19,21-23H,3,7,10-18H2,1-2H3;1-2H3 |
| InChIKey | FPDGUZHJNOSIDA-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.65 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |