About ethane;6-(3-ethyl-4-methylanilino)-3-[(E)-4-hydroxybut-2-enyl]-1H-pyrimidine-2,4-dione
ethane;6-(3-ethyl-4-methylanilino)-3-[(E)-4-hydroxybut-2-enyl]-1H-pyrimidine-2,4-dione (PubChem CID 142209899) has the molecular formula C19H27N3O3
and a molecular weight of 345.44 g/mol. Its IUPAC name is ethane;6-(3-ethyl-4-methylanilino)-3-[(E)-4-hydroxybut-2-enyl]-1H-pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | ethane;6-(3-ethyl-4-methylanilino)-3-[(E)-4-hydroxybut-2-enyl]-1H-pyrimidine-2,4-dione |
| PubChem CID | 142209899 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | ethane;6-(3-ethyl-4-methylanilino)-3-[(E)-4-hydroxybut-2-enyl]-1H-pyrimidine-2,4-dione |
| SMILES | CC.CCc1cc(Nc2cc(=O)n(C/C=C/CO)c(=O)[nH]2)ccc1C |
| InChI | InChI=1S/C17H21N3O3.C2H6/c1-3-13-10-14(7-6-12(13)2)18-15-11-16(22)20(17(23)19-15)8-4-5-9-21;1-2/h4-7,10-11,18,21H,3,8-9H2,1-2H3,(H,19,23);1-2H3/b5-4+; |
| InChIKey | DVUUCHULMVSALY-FXRZFVDSSA-N |
| XLogP | 2.73 |
| TPSA | 87.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;6-(3-ethyl-4-methylanilino)-3-[(E)-4-hydroxybut-2-enyl]-1H-pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;6-(3-ethyl-4-methylanilino)-3-[(E)-4-hydroxybut-2-enyl]-1H-pyrimidine-2,4-dione?
The IUPAC name of ethane;6-(3-ethyl-4-methylanilino)-3-[(E)-4-hydroxybut-2-enyl]-1H-pyrimidine-2,4-dione (CID 142209899) is ethane;6-(3-ethyl-4-methylanilino)-3-[(E)-4-hydroxybut-2-enyl]-1H-pyrimidine-2,4-dione.
What is the SMILES notation for ethane;6-(3-ethyl-4-methylanilino)-3-[(E)-4-hydroxybut-2-enyl]-1H-pyrimidine-2,4-dione?
The canonical SMILES for ethane;6-(3-ethyl-4-methylanilino)-3-[(E)-4-hydroxybut-2-enyl]-1H-pyrimidine-2,4-dione is CC.CCc1cc(Nc2cc(=O)n(C/C=C/CO)c(=O)[nH]2)ccc1C.
What is the InChIKey of ethane;6-(3-ethyl-4-methylanilino)-3-[(E)-4-hydroxybut-2-enyl]-1H-pyrimidine-2,4-dione?
The InChIKey is DVUUCHULMVSALY-FXRZFVDSSA-N. The full InChI is InChI=1S/C17H21N3O3.C2H6/c1-3-13-10-14(7-6-12(13)2)18-15-11-16(22)20(17(23)19-15)8-4-5-9-21;1-2/h4-7,10-11,18,21H,3,8-9H2,1-2H3,(H,19,23);1-2H3/b5-4+;.
What are the key properties of ethane;6-(3-ethyl-4-methylanilino)-3-[(E)-4-hydroxybut-2-enyl]-1H-pyrimidine-2,4-dione?
ethane;6-(3-ethyl-4-methylanilino)-3-[(E)-4-hydroxybut-2-enyl]-1H-pyrimidine-2,4-dione has a molecular weight of 345.44 g/mol, XLogP of 2.73, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;6-(3-ethyl-4-methylanilino)-3-[(E)-4-hydroxybut-2-enyl]-1H-pyrimidine-2,4-dione is sourced from PubChem (CID 142209899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).