C31H48N4O3 — CID 142209901
ethane;6-(3-ethyl-4-methylanilino)-3-[4-[4-[(2E,5Z)-hepta-2,5-dien-3-yl]-4-hydroxypiperidin-1-yl]butyl]-1H-pyrimidine-2,4-dione (PubChem CID 142209901) has the molecular formula C31H48N4O3 and a molecular weight of 524.75 g/mol. Its IUPAC name is ethane;6-(3-ethyl-4-methylanilino)-3-[4-[4-[(2E,5Z)-hepta-2,5-dien-3-yl]-4-hydroxypiperidin-1-yl]butyl]-1H-pyrimidine-2,4-dione.
| Compound Name | ethane;6-(3-ethyl-4-methylanilino)-3-[4-[4-[(2E,5Z)-hepta-2,5-dien-3-yl]-4-hydroxypiperidin-1-yl]butyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 142209901 |
| Molecular Formula | C31H48N4O3 |
| Molecular Weight | 524.75 g/mol |
| Exact Mass | 524.37 |
| IUPAC Name | ethane;6-(3-ethyl-4-methylanilino)-3-[4-[4-[(2E,5Z)-hepta-2,5-dien-3-yl]-4-hydroxypiperidin-1-yl]butyl]-1H-pyrimidine-2,4-dione |
| SMILES | C/C=C\C/C(=C\C)C1(O)CCN(CCCCn2c(=O)cc(Nc3ccc(C)c(CC)c3)[nH]c2=O)CC1.CC |
| InChI | InChI=1S/C29H42N4O3.C2H6/c1-5-8-11-24(7-3)29(36)14-18-32(19-15-29)16-9-10-17-33-27(34)21-26(31-28(33)35)30-25-13-12-22(4)23(6-2)20-25;1-2/h5,7-8,12-13,20-21,30,36H,6,9-11,14-19H2,1-4H3,(H,31,35);1-2H3/b8-5-,24-7+; |
| InChIKey | CXZCEKVOVBUBIZ-CRKLHWMISA-N |
| XLogP | 5.70 |
| TPSA | 90.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.75 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|