C14H18O3 — CID 142209991
ethane;2-(5-methoxy-3H-inden-1-yl)acetic acid (PubChem CID 142209991) has the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. Its IUPAC name is ethane;2-(5-methoxy-3H-inden-1-yl)acetic acid.
| Compound Name | ethane;2-(5-methoxy-3H-inden-1-yl)acetic acid |
|---|---|
| PubChem CID | 142209991 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | ethane;2-(5-methoxy-3H-inden-1-yl)acetic acid |
| SMILES | CC.COc1ccc2c(c1)CC=C2CC(=O)O |
| InChI | InChI=1S/C12H12O3.C2H6/c1-15-10-4-5-11-8(6-10)2-3-9(11)7-12(13)14;1-2/h3-6H,2,7H2,1H3,(H,13,14);1-2H3 |
| InChIKey | BSMKESZLSAWSMG-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |